The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8alpha-H-2beta-Allyl-2alpha-methoxymethyl-salvinorin ether ID: ALA3622715
PubChem CID: 122191994
Max Phase: Preclinical
Molecular Formula: C26H34O7
Molecular Weight: 458.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C=CC[C@]1(COC)C[C@@H](C(=O)OC)[C@]2(C)CC[C@@H]3C(=O)O[C@H](c4ccoc4)C[C@]3(C)[C@H]2C1=O
Standard InChI: InChI=1S/C26H34O7/c1-6-9-26(15-30-4)12-18(22(28)31-5)24(2)10-7-17-23(29)33-19(16-8-11-32-14-16)13-25(17,3)20(24)21(26)27/h6,8,11,14,17-20H,1,7,9-10,12-13,15H2,2-5H3/t17-,18+,19+,20+,24+,25+,26-/m1/s1
Standard InChI Key: XKFMTFBISBVELP-YHDXOSERSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
-3.4277 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4277 -1.5498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1332 -2.2973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1332 0.6928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8205 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8205 -1.5498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4558 -2.2973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7503 -1.5498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4558 0.6928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7503 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0631 0.6928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0631 2.1879 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7503 2.9537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4558 2.1879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7457 4.4544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9502 5.3263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4721 6.7481 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9721 6.7328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5232 5.3015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1389 -3.7982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8426 -4.5544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1807 -4.3938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1361 1.6928 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0907 0.0732 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.3694 1.4804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0581 2.2104 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8473 -5.7544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8278 -2.7497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4036 1.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6067 -0.5164 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.6835 -0.5051 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.7058 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0385 3.4102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9939 0.0203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.0426 -0.5630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 1 0
5 9 1 0
6 7 1 0
7 8 1 0
8 10 1 0
9 10 1 0
9 14 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
15 16 2 0
16 17 1 0
17 18 1 0
18 19 2 0
19 15 1 0
13 15 1 1
20 21 1 0
20 22 2 0
3 20 1 6
4 23 2 0
11 24 2 0
1 25 1 0
25 26 1 0
21 27 1 0
6 28 1 6
9 29 1 6
10 30 1 6
5 31 1 1
1 32 1 1
26 33 1 0
32 34 1 0
34 35 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 458.55Molecular Weight (Monoisotopic): 458.2305AlogP: 4.28#Rotatable Bonds: 6Polar Surface Area: 92.04Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.87CX LogD: 3.87Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.46Np Likeness Score: 2.22
References 1. Lee DY, Deng G, Ma Z, Xu W, Yang L, Liu J, Dai R, Liu-Chen LY.. (2015) Synthesis and biological evaluation of 2-alkyl-2-methoxymethyl-salvinorin ethers as selective κ-opioid receptor agonists., 25 (20): [PMID:26330078 ] [10.1016/j.bmcl.2015.06.092 ]