The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S)-5-[4-(4-{[(tert-butoxy)carbonyl]amino}methylphenyl)-1H-1,2,3-triazol-1-yl]-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}pentanoic acid ID: ALA3627749
PubChem CID: 122192876
Max Phase: Preclinical
Molecular Formula: C33H35N5O6
Molecular Weight: 597.67
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)OC(=O)Nc1ccc(-c2cn(CCC[C@H](NC(=O)OCC3c4ccccc4-c4ccccc43)C(=O)O)nn2)cc1
Standard InChI: InChI=1S/C33H35N5O6/c1-33(2,3)44-32(42)34-22-16-14-21(15-17-22)29-19-38(37-36-29)18-8-13-28(30(39)40)35-31(41)43-20-27-25-11-6-4-9-23(25)24-10-5-7-12-26(24)27/h4-7,9-12,14-17,19,27-28H,8,13,18,20H2,1-3H3,(H,34,42)(H,35,41)(H,39,40)/t28-/m0/s1
Standard InChI Key: WSTXXFRRXUUZFV-NDEPHWFRSA-N
Molfile:
RDKit 2D
44 48 0 0 0 0 0 0 0 0999 V2000
1.2274 0.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2274 0.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2274 -0.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4915 -1.3190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7006 -0.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7006 0.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4915 1.5389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.3190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2274 -0.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4732 -1.3190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7372 -0.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7372 0.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4732 1.5389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 -2.8205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3039 -3.5691 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3070 -5.0699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2688 -5.6717 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6078 -5.8185 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6109 -7.3193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3140 -8.0747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3178 -9.2747 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2727 -7.4783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9117 -8.0679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9148 -9.5687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2156 -10.3172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2187 -11.8181 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4322 -12.6779 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9687 -14.1045 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4687 -14.1045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0052 -12.6779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5866 -15.3186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0911 -16.7260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1206 -17.8697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6448 -17.6011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1395 -16.1888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1100 -15.0451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6714 -18.7435 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8047 -18.4727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7781 -19.6151 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2070 -17.3421 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2543 -19.3442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0326 -20.2576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4345 -19.1271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6566 -18.2137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
5 4 2 0
6 5 1 0
7 6 2 0
2 7 1 0
3 8 1 0
9 8 1 0
1 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
1 13 1 0
8 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
16 18 1 0
18 19 1 0
19 20 1 1
20 21 2 0
20 22 1 0
19 23 1 0
23 24 1 0
24 25 1 0
26 25 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
26 30 1 0
31 29 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
31 36 1 0
34 37 1 0
37 38 1 0
38 39 1 0
38 40 2 0
39 41 1 0
41 42 1 0
41 43 1 0
41 44 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 597.67Molecular Weight (Monoisotopic): 597.2587AlogP: 6.06#Rotatable Bonds: 10Polar Surface Area: 144.67Molecular Species: ACIDHBA: 8HBD: 3#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 3CX Acidic pKa: 3.67CX Basic pKa: ┄CX LogP: 6.06CX LogD: 2.74Aromatic Rings: 4Heavy Atoms: 44QED Weighted: 0.20Np Likeness Score: -0.94
References 1. Cominetti MM, Goffin SA, Raffel E, Turner KD, Ramoutar JC, O'Connell MA, Howell LA, Searcey M.. (2015) Identification of a new p53/MDM2 inhibitor motif inspired by studies of chlorofusin., 25 (21): [PMID:26115576 ] [10.1016/j.bmcl.2015.06.014 ]