(2-Phenylbenzo[h]quinolin-4-yl)methanol

ID: ALA3627927

PubChem CID: 122193006

Max Phase: Preclinical

Molecular Formula: C20H15NO

Molecular Weight: 285.35

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  OCc1cc(-c2ccccc2)nc2c1ccc1ccccc12

Standard InChI:  InChI=1S/C20H15NO/c22-13-16-12-19(15-7-2-1-3-8-15)21-20-17-9-5-4-6-14(17)10-11-18(16)20/h1-12,22H,13H2

Standard InChI Key:  SSKGARACRPSXPI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 22 25  0  0  0  0  0  0  0  0999 V2000
    1.7503   -1.5498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4558   -2.2973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8205   -1.5498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8205    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1332    0.6928    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4277    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4277   -1.5498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1332   -2.2973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4558    0.6928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7503    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0631    0.6928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0631    2.1879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7503    2.9537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4558    2.1879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7151    0.7712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0346    0.0592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3115    0.8463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2683    2.3456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9482    3.0579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6713    2.2708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1451   -3.7981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1887   -4.3905    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1 10  2  0
  9  4  2  0
  3  2  2  0
  2  1  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
  6 15  1  0
 21 22  1  0
  8 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3627927

    ---

Associated Targets(Human)

INPP5D Tbio Phosphatidylinositol-3,4,5-trisphosphate 5-phosphatase 1 (17 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
INPPL1 Tchem Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2 (180 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 285.35Molecular Weight (Monoisotopic): 285.1154AlogP: 4.55#Rotatable Bonds: 2
Polar Surface Area: 33.12Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: HBA (Lipinski): 2HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.70CX LogP: 4.39CX LogD: 4.39
Aromatic Rings: 4Heavy Atoms: 22QED Weighted: 0.55Np Likeness Score: -0.26

References

1. Russo CM, Adhikari AA, Wallach DR, Fernandes S, Balch AN, Kerr WG, Chisholm JD..  (2015)  Synthesis and initial evaluation of quinoline-based inhibitors of the SH2-containing inositol 5'-phosphatase (SHIP).,  25  (22): [PMID:26453006] [10.1016/j.bmcl.2015.09.034]

Source