(1S,14S,25R)-25-Isopropyl-12-methyl-2-oxa-16,17-dithia-12,24,27-triaza-tricyclo[12.7.6.0*5,10*]heptacosa-5(10),6,8,20-tetraene-3,13,23,26-tetraone

ID: ALA3628311

PubChem CID: 122193356

Max Phase: Preclinical

Molecular Formula: C25H33N3O5S2

Molecular Weight: 519.69

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)[C@H]1NC(=O)C[C@H]2/C=C/CCSSC[C@@H](NC1=O)C(=O)N(C)Cc1ccccc1CC(=O)O2

Standard InChI:  InChI=1S/C25H33N3O5S2/c1-16(2)23-24(31)26-20-15-35-34-11-7-6-10-19(13-21(29)27-23)33-22(30)12-17-8-4-5-9-18(17)14-28(3)25(20)32/h4-6,8-10,16,19-20,23H,7,11-15H2,1-3H3,(H,26,31)(H,27,29)/b10-6+/t19-,20-,23-/m1/s1

Standard InChI Key:  MXAXSOYGZMAROX-QHSSBYAUSA-N

Molfile:  

     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
    2.7184    2.7184    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4712    3.5517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.8444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8444    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5517   -1.4712    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6604    1.9304    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5517    1.4712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3542    0.0030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9528    1.0430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9559   -1.0352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4712    3.5517    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    5.0444    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7184   -2.7184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5669   -3.5669    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4712   -3.5517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.8444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5517   -1.4712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7184   -2.7184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4712   -3.5517    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5669   -3.5669    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4186    3.3206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0858    3.5112    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3725    2.6742    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9022    1.2309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4171   -0.2132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0746   -0.8703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0285   -2.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7184    2.7184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5517    1.4712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8444    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2718   -0.4808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3996    0.5082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1069    1.9794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6866    2.4616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9304    4.6604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8396   -3.3012    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4712    3.5419    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  4  5  1  0
  6  7  2  0
  7  4  1  0
  7  1  1  0
  4  8  1  1
  8  9  1  0
  8 10  1  0
  3 11  1  0
  3 12  2  0
  5 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  1  0
 16 19  1  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
  2 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 16 27  1  0
 27 26  2  0
 11 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 17 30  1  0
 11 35  1  0
 16 36  1  1
  2 37  1  1
M  END

Alternative Forms

  1. Parent:

    ALA3628311

    ---

Associated Targets(Human)

IGROV-1 (47897 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HCT-116 (91556 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 519.69Molecular Weight (Monoisotopic): 519.1862AlogP: 2.47#Rotatable Bonds: 1
Polar Surface Area: 104.81Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.86CX Basic pKa: CX LogP: 1.92CX LogD: 1.92
Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.33Np Likeness Score: 1.73

References

1. Ni M, Esposito E, Raj VP, Muzi L, Zunino F, Zuco V, Cominetti D, Penco S, Dal Pozzo A..  (2015)  New macrocyclic analogs of the natural histone deacetylase inhibitor FK228; design, synthesis and preliminary biological evaluation.,  23  (21): [PMID:26481659] [10.1016/j.bmc.2015.10.004]

Source