The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA3628317
PubChem CID: 122193362
Max Phase: Preclinical
Molecular Formula: C26H32N4O5S2
Molecular Weight: 544.70
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)[C@H]1NC(=O)C[C@H]2/C=C/CCSSC[C@@H](NC1=O)C(=O)NCc1[nH]c3ccccc3c1CC(=O)O2
Standard InChI: InChI=1S/C26H32N4O5S2/c1-15(2)24-26(34)29-21-14-37-36-10-6-5-7-16(11-22(31)30-24)35-23(32)12-18-17-8-3-4-9-19(17)28-20(18)13-27-25(21)33/h3-5,7-9,15-16,21,24,28H,6,10-14H2,1-2H3,(H,27,33)(H,29,34)(H,30,31)/b7-5+/t16-,21-,24-/m1/s1
Standard InChI Key: GLQCINVYCFYXCM-OZCPAXMRSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
2.7184 2.7184 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4712 3.5517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.8444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8444 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5517 -1.4712 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6604 1.9304 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5517 1.4712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3542 0.0030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9528 1.0430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9559 -1.0352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4712 3.5517 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 5.0444 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7184 -2.7184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5669 -3.5669 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4712 -3.5517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.8444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5517 -1.4712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7184 -2.7184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4712 -3.5517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5669 -3.5669 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4186 3.3206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0858 3.5112 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.3725 2.6742 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.9022 1.2309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4171 -0.2132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0746 -0.8703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0285 -2.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7184 2.7184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5517 1.4712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8444 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8667 2.2053 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.9682 1.1871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3402 -0.1751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2047 -1.3995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.6984 -1.2623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.3264 0.0999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.4607 1.3249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8396 -3.3012 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.4712 3.5419 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
4 5 1 0
6 7 2 0
7 4 1 0
7 1 1 0
4 8 1 1
8 9 1 0
8 10 1 0
3 11 1 0
3 12 2 0
5 13 1 0
13 14 2 0
13 15 1 0
15 16 1 0
16 19 1 0
17 18 1 0
18 19 1 0
18 20 2 0
2 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
16 27 1 0
27 26 2 0
11 28 1 0
28 29 1 0
17 30 1 0
29 30 2 0
30 33 1 0
32 31 1 0
31 29 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
16 38 1 1
2 39 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 544.70Molecular Weight (Monoisotopic): 544.1814AlogP: 2.61#Rotatable Bonds: 1Polar Surface Area: 129.39Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.86CX Basic pKa: ┄CX LogP: 1.72CX LogD: 1.72Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.25Np Likeness Score: 1.78
References 1. Ni M, Esposito E, Raj VP, Muzi L, Zunino F, Zuco V, Cominetti D, Penco S, Dal Pozzo A.. (2015) New macrocyclic analogs of the natural histone deacetylase inhibitor FK228; design, synthesis and preliminary biological evaluation., 23 (21): [PMID:26481659 ] [10.1016/j.bmc.2015.10.004 ]