The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((2R,4S)-4-((2S,3S)-2-(2-(Dimethylamino)acetamido)-3-methylpentanamido)tetrahydro-2H-pyran-2-yl)-N-phenethylthiazole-4-carboxamide ID: ALA3628394
PubChem CID: 122193421
Max Phase: Preclinical
Molecular Formula: C27H39N5O4S
Molecular Weight: 529.71
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@H](C)[C@H](NC(=O)CN(C)C)C(=O)N[C@H]1CCO[C@@H](c2nc(C(=O)NCCc3ccccc3)cs2)C1
Standard InChI: InChI=1S/C27H39N5O4S/c1-5-18(2)24(31-23(33)16-32(3)4)26(35)29-20-12-14-36-22(15-20)27-30-21(17-37-27)25(34)28-13-11-19-9-7-6-8-10-19/h6-10,17-18,20,22,24H,5,11-16H2,1-4H3,(H,28,34)(H,29,35)(H,31,33)/t18-,20-,22+,24-/m0/s1
Standard InChI Key: BFJOYFRPRSLZTN-UXEORXRVSA-N
Molfile:
RDKit 2D
37 39 0 0 0 0 0 0 0 0999 V2000
3.8912 -5.2578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1929 -3.0062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2321 -3.6062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1933 -1.5053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2324 -0.9050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5548 -3.6021 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2122 3.8625 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.7464 5.2884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7536 5.2860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2149 3.8587 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6387 6.4949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1543 7.5928 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1308 6.3335 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0174 7.5444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5095 7.3831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3961 8.5940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8877 8.4349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7713 9.6470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1634 11.0183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6719 11.1775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7883 9.9654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1894 -6.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1873 -7.5117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2297 -5.4127 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4855 -8.2648 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4838 -9.4648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5257 -7.6666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 6
2 3 1 0
2 4 1 0
4 5 1 6
4 6 1 0
6 7 1 0
3 8 2 0
3 9 1 0
10 9 1 1
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
12 16 1 1
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 16 2 0
19 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
1 32 1 0
32 33 1 0
32 34 2 0
33 35 1 0
35 36 1 0
35 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 529.71Molecular Weight (Monoisotopic): 529.2723AlogP: 2.54#Rotatable Bonds: 12Polar Surface Area: 112.66Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.05CX Basic pKa: 7.20CX LogP: 1.98CX LogD: 1.77Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.39Np Likeness Score: -0.85
References 1. Park Y, Bae SY, Hah JM, Lee SK, Ryu JS.. (2015) Synthesis of stereochemically diverse cyclic analogs of tubulysins., 23 (21): [PMID:26474666 ] [10.1016/j.bmc.2015.10.003 ]