The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-Fluoro-4-((4-((3-morpholinopropyl)amino)phenyl)amino)quinoline-3-carbohydrazide ID: ALA3628446
PubChem CID: 122193459
Max Phase: Preclinical
Molecular Formula: C23H27FN6O2
Molecular Weight: 438.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NNC(=O)c1cnc2ccc(F)cc2c1Nc1ccc(NCCCN2CCOCC2)cc1
Standard InChI: InChI=1S/C23H27FN6O2/c24-16-2-7-21-19(14-16)22(20(15-27-21)23(31)29-25)28-18-5-3-17(4-6-18)26-8-1-9-30-10-12-32-13-11-30/h2-7,14-15,26H,1,8-13,25H2,(H,27,28)(H,29,31)
Standard InChI Key: QDROYHQONXRDAX-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
-1.2964 1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9122 -1.4966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9138 -2.4966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2109 -0.7445 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 -2.9981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5870 -3.7544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5835 -5.2544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8807 -6.0076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1815 -5.2608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1852 -3.7608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8880 -3.0076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4810 -6.0117 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.7815 -5.2626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0810 -6.0135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3815 -5.2644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.2755 -7.5217 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-14.2791 -6.0217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9819 -5.2686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6810 -6.0154 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-11.6774 -7.5154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9746 -8.2686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2513 -1.3425 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6321 -1.3486 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
1 10 1 0
5 10 1 0
11 12 2 0
11 13 1 0
3 11 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
15 20 2 0
22 23 1 0
23 24 1 0
21 22 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
25 30 1 0
24 28 1 0
18 21 1 0
14 15 1 0
4 14 1 0
13 31 1 0
7 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 438.51Molecular Weight (Monoisotopic): 438.2180AlogP: 2.86#Rotatable Bonds: 8Polar Surface Area: 104.54Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.81CX Basic pKa: 7.37CX LogP: 2.90CX LogD: 2.62Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.19Np Likeness Score: -1.83
References 1. Medapi B, Suryadevara P, Renuka J, Sridevi JP, Yogeeswari P, Sriram D.. (2015) 4-Aminoquinoline derivatives as novel Mycobacterium tuberculosis GyrB inhibitors: Structural optimization, synthesis and biological evaluation., 103 [PMID:26318054 ] [10.1016/j.ejmech.2015.06.032 ]