The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((4-(3-(4-Ethylpiperazin-1-yl)propoxy)phenyl)amino)-6-methoxyquinoline-3-carbohydrazide ID: ALA3628448
PubChem CID: 122193462
Max Phase: Preclinical
Molecular Formula: C26H34N6O3
Molecular Weight: 478.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN1CCN(CCCOc2ccc(Nc3c(C(=O)NN)cnc4ccc(OC)cc34)cc2)CC1
Standard InChI: InChI=1S/C26H34N6O3/c1-3-31-12-14-32(15-13-31)11-4-16-35-20-7-5-19(6-8-20)29-25-22-17-21(34-2)9-10-24(22)28-18-23(25)26(33)30-27/h5-10,17-18H,3-4,11-16,27H2,1-2H3,(H,28,29)(H,30,33)
Standard InChI Key: JBAKTOQVABZRQH-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
-1.2964 1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9122 -1.4966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9138 -2.4966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2109 -0.7445 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 -2.9981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5870 -3.7544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5835 -5.2544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8807 -6.0076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1815 -5.2608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1852 -3.7608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8880 -3.0076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4810 -6.0117 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.7815 -5.2626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0810 -6.0135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3815 -5.2644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.2755 -7.5217 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-14.2791 -6.0217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9819 -5.2686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6810 -6.0154 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-11.6774 -7.5154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9746 -8.2686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2513 -1.3425 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-15.5719 -8.2779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.5672 -9.4779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8942 -1.4964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9326 -0.8949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
1 10 1 0
5 10 1 0
11 12 2 0
11 13 1 0
3 11 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
15 20 2 0
22 23 1 0
23 24 1 0
21 22 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
25 30 1 0
24 28 1 0
18 21 1 0
14 15 1 0
4 14 1 0
13 31 1 0
25 32 1 0
32 33 1 0
34 35 1 0
7 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 478.60Molecular Weight (Monoisotopic): 478.2692AlogP: 3.00#Rotatable Bonds: 10Polar Surface Area: 104.98Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.88CX Basic pKa: 8.10CX LogP: 3.39CX LogD: 2.44Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.18Np Likeness Score: -1.40
References 1. Medapi B, Suryadevara P, Renuka J, Sridevi JP, Yogeeswari P, Sriram D.. (2015) 4-Aminoquinoline derivatives as novel Mycobacterium tuberculosis GyrB inhibitors: Structural optimization, synthesis and biological evaluation., 103 [PMID:26318054 ] [10.1016/j.ejmech.2015.06.032 ]