The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((4-((3-(4-Ethylpiperazin-1-yl)propyl)amino)phenyl)amino)-6-(trifluoromethyl)quinoline-3-carbohydrazide ID: ALA3628454
PubChem CID: 122193468
Max Phase: Preclinical
Molecular Formula: C26H32F3N7O
Molecular Weight: 515.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN1CCN(CCCNc2ccc(Nc3c(C(=O)NN)cnc4ccc(C(F)(F)F)cc34)cc2)CC1
Standard InChI: InChI=1S/C26H32F3N7O/c1-2-35-12-14-36(15-13-35)11-3-10-31-19-5-7-20(8-6-19)33-24-21-16-18(26(27,28)29)4-9-23(21)32-17-22(24)25(37)34-30/h4-9,16-17,31H,2-3,10-15,30H2,1H3,(H,32,33)(H,34,37)
Standard InChI Key: QZLZISHMGGDYHF-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
-1.2964 1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9122 -1.4966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9138 -2.4966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2109 -0.7445 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 -2.9981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5870 -3.7544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5835 -5.2544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8807 -6.0076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1815 -5.2608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1852 -3.7608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8880 -3.0076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4810 -6.0117 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.7815 -5.2626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0810 -6.0135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3815 -5.2644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.2755 -7.5217 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-14.2791 -6.0217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9819 -5.2686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6810 -6.0154 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-11.6774 -7.5154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9746 -8.2686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2513 -1.3425 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-15.5719 -8.2779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.5672 -9.4779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8926 -1.4991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8934 -2.6991 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.9317 -0.8987 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.9322 -2.0986 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
1 10 1 0
5 10 1 0
11 12 2 0
11 13 1 0
3 11 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
15 20 2 0
22 23 1 0
23 24 1 0
21 22 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
25 30 1 0
24 28 1 0
18 21 1 0
14 15 1 0
4 14 1 0
13 31 1 0
25 32 1 0
32 33 1 0
34 35 1 0
34 36 1 0
34 37 1 0
7 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 515.58Molecular Weight (Monoisotopic): 515.2620AlogP: 4.04#Rotatable Bonds: 9Polar Surface Area: 98.55Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.80CX Basic pKa: 8.40CX LogP: 4.06CX LogD: 3.02Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.15Np Likeness Score: -1.61
References 1. Medapi B, Suryadevara P, Renuka J, Sridevi JP, Yogeeswari P, Sriram D.. (2015) 4-Aminoquinoline derivatives as novel Mycobacterium tuberculosis GyrB inhibitors: Structural optimization, synthesis and biological evaluation., 103 [PMID:26318054 ] [10.1016/j.ejmech.2015.06.032 ]