The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-Fluoro-4-((4-(3-morpholinopropoxy)phenyl)amino)quinoline-3-carboxylic acid ID: ALA3628457
PubChem CID: 122193471
Max Phase: Preclinical
Molecular Formula: C23H24FN3O4
Molecular Weight: 425.46
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1cnc2ccc(F)cc2c1Nc1ccc(OCCCN2CCOCC2)cc1
Standard InChI: InChI=1S/C23H24FN3O4/c24-16-2-7-21-19(14-16)22(20(15-25-21)23(28)29)26-17-3-5-18(6-4-17)31-11-1-8-27-9-12-30-13-10-27/h2-7,14-15H,1,8-13H2,(H,25,26)(H,28,29)
Standard InChI Key: VWANAVLMRAYBBH-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
-1.2964 1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9122 -1.4966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9506 -0.8952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 -2.9981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5870 -3.7544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5835 -5.2544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8807 -6.0076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1815 -5.2608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1852 -3.7608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8880 -3.0076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4810 -6.0117 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.7815 -5.2626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0810 -6.0135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3815 -5.2644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.2755 -7.5217 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-14.2791 -6.0217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9819 -5.2686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6810 -6.0154 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-11.6774 -7.5154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9746 -8.2686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9138 -2.4966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6321 -1.3486 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
1 10 1 0
5 10 1 0
11 12 2 0
3 11 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
14 19 2 0
21 22 1 0
22 23 1 0
20 21 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
24 29 1 0
23 27 1 0
17 20 1 0
13 14 1 0
4 13 1 0
11 30 1 0
7 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 425.46Molecular Weight (Monoisotopic): 425.1751AlogP: 3.92#Rotatable Bonds: 8Polar Surface Area: 83.92Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 2.25CX Basic pKa: 7.19CX LogP: 1.93CX LogD: 1.79Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.53Np Likeness Score: -1.65
References 1. Medapi B, Suryadevara P, Renuka J, Sridevi JP, Yogeeswari P, Sriram D.. (2015) 4-Aminoquinoline derivatives as novel Mycobacterium tuberculosis GyrB inhibitors: Structural optimization, synthesis and biological evaluation., 103 [PMID:26318054 ] [10.1016/j.ejmech.2015.06.032 ]