N-(3-(5-(2,6-difluoro-3-hydroxybenzoyl)thiophene-2-yl)phenyl)-2-trifluoromethoxybenzenesulfonamide

ID: ALA3629586

PubChem CID: 122194411

Max Phase: Preclinical

Molecular Formula: C24H14F5NO5S2

Molecular Weight: 555.50

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(c1ccc(-c2cccc(NS(=O)(=O)c3ccccc3OC(F)(F)F)c2)s1)c1c(F)ccc(O)c1F

Standard InChI:  InChI=1S/C24H14F5NO5S2/c25-15-8-9-16(31)22(26)21(15)23(32)19-11-10-18(36-19)13-4-3-5-14(12-13)30-37(33,34)20-7-2-1-6-17(20)35-24(27,28)29/h1-12,30-31H

Standard InChI Key:  VPUOBTGZCXRQOY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
    4.6017  -12.1261    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4020  -12.0971    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.0271  -11.0728    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6837  -10.7794    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3383    1.3500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0031   -3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3039   -3.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4469   -5.2297    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.9152   -5.5365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6607   -4.2349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6532   -3.1236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0351   -3.6026    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5304   -6.9054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7488   -8.1798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4649   -9.4979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9644   -9.5368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7478   -8.2576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0317   -6.9396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383   -1.3500    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.3383   -1.3500    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.6208  -13.3786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3396  -14.6952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5588  -15.9759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0592  -15.9401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3405  -14.6236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1212  -13.3428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3993  -12.0270    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1011  -11.9933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6783  -10.9412    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7239  -13.0190    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3008  -11.9669    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  6 11  1  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 13  2  0
 12 18  2  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 15 19  1  0
 21  4  1  0
  9 25  1  0
  5 26  1  0
  4  2  1  0
  2 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 34 36  1  0
 34 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3629586

    ---

Associated Targets(Human)

HSD17B1 Tchem Estradiol 17-beta-dehydrogenase 1 (2224 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HSD17B2 Tchem Estradiol 17-beta-dehydrogenase 2 (1671 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Hsd17b1 Estradiol 17-beta-dehydrogenase 1 (138 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Hsd17b1 Estradiol 17-beta-dehydrogenase 1 (16 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Hsd17b2 Estradiol 17-beta-dehydrogenase 2 (138 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Hsd17b2 Estradiol 17-beta-dehydrogenase 2 (21 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 555.50Molecular Weight (Monoisotopic): 555.0234AlogP: 6.33#Rotatable Bonds: 7
Polar Surface Area: 92.70Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 6.83CX Basic pKa: CX LogP: 6.89CX LogD: 6.23
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.21Np Likeness Score: -1.37

References

1. Abdelsamie AS, Bey E, Gargano EM, van Koppen CJ, Empting M, Frotscher M..  (2015)  Towards the evaluation in an animal disease model: Fluorinated 17β-HSD1 inhibitors showing strong activity towards both the human and the rat enzyme.,  103  [PMID:26322835] [10.1016/j.ejmech.2015.08.030]

Source