The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(hydroxy(2-phenylbenzo[h]quinolin-4-yl)methyl)piperidinium 3-carboxy-2-(carboxymethyl)-2-hydroxypropanoate ID: ALA3629617
PubChem CID: 145949126
Max Phase: Preclinical
Molecular Formula: C31H32N2O8
Molecular Weight: 368.48
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)CC(O)(CC(=O)O)C(=O)O.OC(c1cc(-c2ccccc2)nc2c1ccc1ccccc12)C1CCCCN1
Standard InChI: InChI=1S/C25H24N2O.C6H8O7/c28-25(22-12-6-7-15-26-22)21-16-23(18-9-2-1-3-10-18)27-24-19-11-5-4-8-17(19)13-14-20(21)24;7-3(8)1-6(13,5(11)12)2-4(9)10/h1-5,8-11,13-14,16,22,25-26,28H,6-7,12,15H2;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)
Standard InChI Key: SODVMWYVKXBRMS-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
6.8630 -2.6182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1630 -3.3682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4630 -2.6182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5019 -3.2189 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4642 -4.1482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4644 -1.1174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7644 -0.3674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8236 -3.2179 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8630 -1.4182 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5036 -4.7480 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5984 -4.6486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7656 0.8326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8033 -0.9681 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1332 0.6928 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4277 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4277 -1.5498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1332 -2.2973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8205 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8205 -1.5498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4558 -2.2973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7503 -1.5498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4558 0.6928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7503 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0631 0.6928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0631 2.1879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7503 2.9537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4558 2.1879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7151 0.7712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7100 2.2705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0065 3.0248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.3080 2.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.3131 0.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0166 0.0249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1451 -3.7981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4504 -4.5389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1105 -4.4061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4645 -6.0389 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.7705 -6.7767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0625 -6.0146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0484 -4.5147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7424 -3.7768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
3 5 1 0
3 6 1 0
6 7 1 0
1 8 2 0
1 9 1 0
5 10 2 0
5 11 1 0
7 12 2 0
7 13 1 0
18 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 19 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 23 2 0
22 18 2 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
15 28 1 0
17 34 1 0
34 35 1 0
34 36 1 0
35 37 1 0
35 41 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 368.48Molecular Weight (Monoisotopic): 368.1889AlogP: 5.23#Rotatable Bonds: 3Polar Surface Area: 45.15Molecular Species: BASEHBA: 3HBD: 2#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.84CX Basic pKa: 9.52CX LogP: 4.99CX LogD: 2.90Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.49Np Likeness Score: 0.13
References 1. Russo CM, Adhikari AA, Wallach DR, Fernandes S, Balch AN, Kerr WG, Chisholm JD.. (2015) Synthesis and initial evaluation of quinoline-based inhibitors of the SH2-containing inositol 5'-phosphatase (SHIP)., 25 (22): [PMID:26453006 ] [10.1016/j.bmcl.2015.09.034 ]