2-(hydroxy(2-phenylbenzo[h]quinolin-4-yl)methyl)piperidinium 3-carboxy-2-(carboxymethyl)-2-hydroxypropanoate

ID: ALA3629617

PubChem CID: 145949126

Max Phase: Preclinical

Molecular Formula: C31H32N2O8

Molecular Weight: 368.48

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)CC(O)(CC(=O)O)C(=O)O.OC(c1cc(-c2ccccc2)nc2c1ccc1ccccc12)C1CCCCN1

Standard InChI:  InChI=1S/C25H24N2O.C6H8O7/c28-25(22-12-6-7-15-26-22)21-16-23(18-9-2-1-3-10-18)27-24-19-11-5-4-8-17(19)13-14-20(21)24;7-3(8)1-6(13,5(11)12)2-4(9)10/h1-5,8-11,13-14,16,22,25-26,28H,6-7,12,15H2;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)

Standard InChI Key:  SODVMWYVKXBRMS-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 41 44  0  0  0  0  0  0  0  0999 V2000
    6.8630   -2.6182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1630   -3.3682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4630   -2.6182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5019   -3.2189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4642   -4.1482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4644   -1.1174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7644   -0.3674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8236   -3.2179    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8630   -1.4182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.5036   -4.7480    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5984   -4.6486    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7656    0.8326    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8033   -0.9681    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1332    0.6928    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4277    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4277   -1.5498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1332   -2.2973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8205    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8205   -1.5498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4558   -2.2973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7503   -1.5498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4558    0.6928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7503    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0631    0.6928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0631    2.1879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7503    2.9537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4558    2.1879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7151    0.7712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7100    2.2705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0065    3.0248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3080    2.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3131    0.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0166    0.0249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1451   -3.7981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4504   -4.5389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1105   -4.4061    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4645   -6.0389    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7705   -6.7767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0625   -6.0146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0484   -4.5147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7424   -3.7768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  3  5  1  0
  3  6  1  0
  6  7  1  0
  1  8  2  0
  1  9  1  0
  5 10  2  0
  5 11  1  0
  7 12  2  0
  7 13  1  0
 18 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 19  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 23  2  0
 22 18  2  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 15 28  1  0
 17 34  1  0
 34 35  1  0
 34 36  1  0
 35 37  1  0
 35 41  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
M  END

Associated Targets(Human)

INPPL1 Tchem Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2 (180 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
INPP5D Tbio Phosphatidylinositol-3,4,5-trisphosphate 5-phosphatase 1 (17 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 368.48Molecular Weight (Monoisotopic): 368.1889AlogP: 5.23#Rotatable Bonds: 3
Polar Surface Area: 45.15Molecular Species: BASEHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.84CX Basic pKa: 9.52CX LogP: 4.99CX LogD: 2.90
Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.49Np Likeness Score: 0.13

References

1. Russo CM, Adhikari AA, Wallach DR, Fernandes S, Balch AN, Kerr WG, Chisholm JD..  (2015)  Synthesis and initial evaluation of quinoline-based inhibitors of the SH2-containing inositol 5'-phosphatase (SHIP).,  25  (22): [PMID:26453006] [10.1016/j.bmcl.2015.09.034]

Source