The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((2S,4S)-4-((2S,3S)-3-Methyl-2-((R)-1-methylpiperidine-2-carboxamido)pentanamido)tetrahydro-2H-pyran-2-yl)-N-phenethylthiazole-4-carboxamide ID: ALA3629729
PubChem CID: 122194541
Max Phase: Preclinical
Molecular Formula: C30H43N5O4S
Molecular Weight: 569.77
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@H](C)[C@H](NC(=O)[C@H]1CCCCN1C)C(=O)N[C@H]1CCO[C@H](c2nc(C(=O)NCCc3ccccc3)cs2)C1
Standard InChI: InChI=1S/C30H43N5O4S/c1-4-20(2)26(34-28(37)24-12-8-9-16-35(24)3)29(38)32-22-14-17-39-25(18-22)30-33-23(19-40-30)27(36)31-15-13-21-10-6-5-7-11-21/h5-7,10-11,19-20,22,24-26H,4,8-9,12-18H2,1-3H3,(H,31,36)(H,32,38)(H,34,37)/t20-,22-,24+,25-,26-/m0/s1
Standard InChI Key: DWODQQODGUJQCS-XSOUBHFCSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 2.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5973 1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6375 0.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5951 3.0039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8933 3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8912 5.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1959 3.0115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2001 1.8115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4933 3.7660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5348 3.1700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8509 5.8560 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.1894 6.0109 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.1873 7.5117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4837 8.2663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4785 9.7663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1769 10.5118 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8805 9.7573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8856 8.2573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7756 10.5211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.9107 12.0023 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-9.3774 12.3169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.1298 11.0192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1282 9.9026 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-11.6198 10.8623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.3250 11.8332 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-12.2308 9.4915 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-13.7234 9.3343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.3344 7.9635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.8270 7.8063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-16.4397 6.4371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-17.9318 6.2831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-18.8112 7.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-18.1986 8.8674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-16.7065 9.0215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
3 7 1 0
4 8 1 6
8 9 2 0
8 10 1 0
11 10 1 1
11 12 1 0
11 13 1 0
13 14 1 1
13 15 1 0
15 16 1 0
12 17 2 0
12 18 1 0
19 18 1 6
19 20 1 0
19 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
21 25 1 1
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 25 2 0
28 30 1 0
30 31 2 0
30 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 569.77Molecular Weight (Monoisotopic): 569.3036AlogP: 3.47#Rotatable Bonds: 11Polar Surface Area: 112.66Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.09CX Basic pKa: 7.09CX LogP: 3.05CX LogD: 2.87Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.38Np Likeness Score: -0.61
References 1. Park Y, Bae SY, Hah JM, Lee SK, Ryu JS.. (2015) Synthesis of stereochemically diverse cyclic analogs of tubulysins., 23 (21): [PMID:26474666 ] [10.1016/j.bmc.2015.10.003 ]