(E)-3-(1-Methyl-1H-imidazol-4-yl)-acrylic acid (E)-(1S,2S,4R,8R,9S,12R)-8-isopropyl-12-methoxy-1,5-dimethyl-11-methylcarbamoyl-15-oxa-tricyclo[10.2.1.0*4,9*]pentadeca-5,10,13-trien-2-yl ester

ID: ALA363201

PubChem CID: 10815550

Max Phase: Preclinical

Molecular Formula: C29H39N3O5

Molecular Weight: 509.65

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNC(=O)/C1=C/[C@@H]2[C@@H](C(C)C)CC=C(C)[C@@H]2C[C@H](OC(=O)/C=C/c2cn(C)cn2)[C@]2(C)C=C[C@@]1(OC)O2

Standard InChI:  InChI=1S/C29H39N3O5/c1-18(2)21-10-8-19(3)22-15-25(36-26(33)11-9-20-16-32(6)17-31-20)28(4)12-13-29(35-7,37-28)24(14-23(21)22)27(34)30-5/h8-9,11-14,16-18,21-23,25H,10,15H2,1-7H3,(H,30,34)/b11-9+,24-14-/t21-,22+,23-,25+,28+,29-/m1/s1

Standard InChI Key:  JGTVZDWLNNFQIC-RZQXXOGCSA-N

Molfile:  

     RDKit          2D

 39 42  0  0  1  0  0  0  0  0999 V2000
    1.2042   -4.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8917   -4.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3958   -4.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0875   -4.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1792   -3.9375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8667   -3.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3958   -3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6375   -1.6417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2042   -5.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1417   -3.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3667   -4.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1083   -4.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3167   -3.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3917   -3.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1083   -3.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3042   -2.9417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9417   -2.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8167   -1.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8208   -3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6125   -2.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8208   -4.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7250   -1.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1417   -2.2625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1042   -1.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5167   -1.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4875   -6.1042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5042   -0.8750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3292   -5.3750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6125   -6.4125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1083   -5.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2667   -2.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3667   -3.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1083   -2.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4042   -6.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8208   -5.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3958   -5.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1542   -5.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4000   -2.6750    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4000   -5.1500    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  4  1  0
  4  1  2  0
  5  2  1  0
  6  5  1  0
  7  3  1  0
  8 18  1  0
  9  1  1  0
 10  6  1  0
 11  2  1  0
 12  3  1  0
 13  7  1  0
 14 11  2  0
 15  7  1  0
 16 20  1  0
 17  8  2  0
 18 24  1  0
 19 21  1  0
 20 18  2  0
 21 12  1  0
 22 23  1  0
 10 23  1  6
 24 25  2  0
 25 22  1  0
 26  9  2  0
 27 22  2  0
  2 28  1  1
 29  9  1  0
 12 30  1  1
  6 31  1  1
 32 16  1  0
 33 15  1  0
 34 29  1  0
 35 30  1  0
 36 30  1  0
 37 28  1  0
  7 38  1  1
  3 39  1  1
  6 14  1  0
 13 10  1  0
 15 19  2  0
 16 17  1  0
M  END

Associated Targets(Human)

1A9 (618 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TUBB4B Tclin Tubulin beta-2 chain (26 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 509.65Molecular Weight (Monoisotopic): 509.2890AlogP: 3.96#Rotatable Bonds: 6
Polar Surface Area: 91.68Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 5.70CX LogP: 4.36CX LogD: 4.35
Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.35Np Likeness Score: 2.06

References

1. Nicolaou KC..  (2005)  Joys of molecules. 2. Endeavors in chemical biology and medicinal chemistry.,  48  (18): [PMID:16134928] [10.1021/jm050524f]
2. Nicolaou KC..  (2005)  Joys of molecules. 2. Endeavors in chemical biology and medicinal chemistry.,  48  (18): [PMID:16134928] [10.1021/jm050524f]

Source