N,N'-(naphthalene-1,3-diyl)bis(4-methoxybenzenesulfonamide)

ID: ALA3632884

PubChem CID: 122194812

Max Phase: Preclinical

Molecular Formula: C24H22N2O6S2

Molecular Weight: 498.58

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(S(=O)(=O)Nc2cc(NS(=O)(=O)c3ccc(OC)cc3)c3ccccc3c2)cc1

Standard InChI:  InChI=1S/C24H22N2O6S2/c1-31-19-7-11-21(12-8-19)33(27,28)25-18-15-17-5-3-4-6-23(17)24(16-18)26-34(29,30)22-13-9-20(32-2)10-14-22/h3-16,25-26H,1-2H3

Standard InChI Key:  AEIOZNSJYSBFEO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
    5.1908    0.4559    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1929   -0.7441    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.1527   -0.1458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6385    3.1449    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003    3.7467    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.5984    2.5467    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2995    2.9981    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6034    5.2475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9040    5.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9071    7.4948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6096    8.2475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3090    7.5002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3059    6.0002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6096    9.7484    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5707   10.3490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8942   -1.4964    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4942   -1.4919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4973   -2.9919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7978   -3.7392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0953   -2.9865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0922   -1.4865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7916   -0.7392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3982   -3.7316    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4353   -3.1279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  5  4  2  0
  6  5  2  0
  7  8  2  0
  8  9  1  0
  9 12  2  0
 11 10  2  0
 10  7  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 16 17  1  0
 17  5  1  0
  5 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21 24  1  0
 24 25  1  0
 14 26  1  0
 26  2  1  0
  2 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 30 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3632884

    ---

Associated Targets(Human)

NFE2L2 Tchem Keap1/Nrf2 (1722 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 498.58Molecular Weight (Monoisotopic): 498.0919AlogP: 4.46#Rotatable Bonds: 8
Polar Surface Area: 110.80Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.53CX Basic pKa: CX LogP: 3.62CX LogD: 3.38
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.37Np Likeness Score: -0.99

References

1. Jain AD, Potteti H, Richardson BG, Kingsley L, Luciano JP, Ryuzoji AF, Lee H, Krunic A, Mesecar AD, Reddy SP, Moore TW..  (2015)  Probing the structural requirements of non-electrophilic naphthalene-based Nrf2 activators.,  103  [PMID:26363505] [10.1016/j.ejmech.2015.08.049]

Source