The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N,N'-(naphthalene-2,3-diyl)bis(4-methoxybenzenesulfonamide) ID: ALA3632885
PubChem CID: 122194813
Max Phase: Preclinical
Molecular Formula: C24H22N2O6S2
Molecular Weight: 498.58
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(S(=O)(=O)Nc2cc3ccccc3cc2NS(=O)(=O)c2ccc(OC)cc2)cc1
Standard InChI: InChI=1S/C24H22N2O6S2/c1-31-19-7-11-21(12-8-19)33(27,28)25-23-15-17-5-3-4-6-18(17)16-24(23)26-34(29,30)22-13-9-20(32-2)10-14-22/h3-16,25-26H,1-2H3
Standard InChI Key: UOZHSQOYXMSKRH-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
2.8487 3.6008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8890 3.0026 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.8507 2.4009 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8487 -3.6008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8890 -3.0026 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.8507 -2.4009 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8911 -1.5017 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1872 -3.7556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1841 -5.2557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4816 -6.0083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7822 -5.2610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7852 -3.7610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4877 -3.0083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0819 -6.0114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1215 -5.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8911 1.5017 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1872 3.7556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4878 3.0083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7852 3.7610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7822 5.2610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4816 6.0083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1841 5.2556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0788 6.0168 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0746 7.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
5 4 2 0
6 5 2 0
7 8 2 0
8 9 1 0
9 12 2 0
11 10 2 0
10 7 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
14 17 1 0
17 5 1 0
5 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
21 24 1 0
24 25 1 0
15 26 1 0
26 2 1 0
2 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
30 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 498.58Molecular Weight (Monoisotopic): 498.0919AlogP: 4.46#Rotatable Bonds: 8Polar Surface Area: 110.80Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.33CX Basic pKa: ┄CX LogP: 3.62CX LogD: 3.23Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.37Np Likeness Score: -0.72
References 1. Jain AD, Potteti H, Richardson BG, Kingsley L, Luciano JP, Ryuzoji AF, Lee H, Krunic A, Mesecar AD, Reddy SP, Moore TW.. (2015) Probing the structural requirements of non-electrophilic naphthalene-based Nrf2 activators., 103 [PMID:26363505 ] [10.1016/j.ejmech.2015.08.049 ]