The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,2'-(naphthalene-1,3-diylbis(((4-methoxyphenyl)sulfonyl)azanediyl))diacetamide ID: ALA3632886
PubChem CID: 122194814
Max Phase: Preclinical
Molecular Formula: C28H28N4O8S2
Molecular Weight: 612.69
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(S(=O)(=O)N(CC(N)=O)c2cc(N(CC(N)=O)S(=O)(=O)c3ccc(OC)cc3)c3ccccc3c2)cc1
Standard InChI: InChI=1S/C28H28N4O8S2/c1-39-21-7-11-23(12-8-21)41(35,36)31(17-27(29)33)20-15-19-5-3-4-6-25(19)26(16-20)32(18-28(30)34)42(37,38)24-13-9-22(40-2)10-14-24/h3-16H,17-18H2,1-2H3,(H2,29,33)(H2,30,34)
Standard InChI Key: XZUZYMRNGWYHDG-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 45 0 0 0 0 0 0 0 0999 V2000
5.1908 0.4559 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1929 -0.7441 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.1527 -0.1458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6385 3.1449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 3.7467 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.5984 2.5467 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2995 2.9981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6034 5.2475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9040 5.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9071 7.4948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6096 8.2475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3090 7.5002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3059 6.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6096 9.7484 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5707 10.3490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0005 3.7481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3005 2.9981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3005 1.9981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3399 3.5978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8942 -1.4964 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4942 -1.4919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4973 -2.9919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7978 -3.7392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0953 -2.9865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0922 -1.4865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7916 -0.7392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8937 -2.9972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5942 -3.7481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5550 -3.1481 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5938 -4.9481 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3982 -3.7316 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4353 -3.1279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
5 4 2 0
6 5 2 0
7 8 2 0
8 9 1 0
9 12 2 0
11 10 2 0
10 7 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
16 17 1 0
17 5 1 0
5 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
21 24 1 0
24 25 1 0
17 26 1 0
26 27 1 0
27 28 1 0
27 29 2 0
14 30 1 0
30 2 1 0
2 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
30 37 1 0
37 38 1 0
38 39 1 0
38 40 2 0
34 41 1 0
41 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 612.69Molecular Weight (Monoisotopic): 612.1349AlogP: 2.22#Rotatable Bonds: 12Polar Surface Area: 179.40Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.84CX Basic pKa: ┄CX LogP: 1.41CX LogD: 1.41Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.24Np Likeness Score: -0.91
References 1. Jain AD, Potteti H, Richardson BG, Kingsley L, Luciano JP, Ryuzoji AF, Lee H, Krunic A, Mesecar AD, Reddy SP, Moore TW.. (2015) Probing the structural requirements of non-electrophilic naphthalene-based Nrf2 activators., 103 [PMID:26363505 ] [10.1016/j.ejmech.2015.08.049 ]