The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(naphthalene-2,3-diylbis(((4-methoxyphenyl)sulfonyl)azanediyl))acetamide ID: ALA3632888
PubChem CID: 122194816
Max Phase: Preclinical
Molecular Formula: C26H25N3O7S2
Molecular Weight: 555.63
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(S(=O)(=O)Nc2cc3ccccc3cc2N(CC(N)=O)S(=O)(=O)c2ccc(OC)cc2)cc1
Standard InChI: InChI=1S/C26H25N3O7S2/c1-35-20-7-11-22(12-8-20)37(31,32)28-24-15-18-5-3-4-6-19(18)16-25(24)29(17-26(27)30)38(33,34)23-13-9-21(36-2)10-14-23/h3-16,28H,17H2,1-2H3,(H2,27,30)
Standard InChI Key: FNWINQBBFOJPCH-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
2.8487 -3.6008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8890 -3.0026 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.8507 -2.4009 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8487 3.6008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8890 3.0026 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.8507 2.4009 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8911 -1.5017 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8911 1.5017 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1872 3.7556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4878 3.0083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7852 3.7610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7822 5.2610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4816 6.0083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1841 5.2556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0788 6.0168 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0746 7.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1872 -3.7556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1841 -5.2557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4816 -6.0083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7822 -5.2610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7852 -3.7610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4877 -3.0083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1906 -0.7509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1911 0.7499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3251 1.2499 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2301 1.3502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0819 -6.0114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1215 -5.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
5 4 2 0
6 5 2 0
7 8 2 0
8 9 1 0
9 12 2 0
11 10 2 0
10 7 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
14 17 1 0
15 18 1 0
18 5 1 0
5 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
22 25 1 0
25 26 1 0
17 2 1 0
2 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
17 33 1 0
33 34 1 0
34 35 1 0
34 36 2 0
30 37 1 0
37 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 555.63Molecular Weight (Monoisotopic): 555.1134AlogP: 3.34#Rotatable Bonds: 10Polar Surface Area: 145.10Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.59CX Basic pKa: ┄CX LogP: 2.52CX LogD: 2.33Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.31Np Likeness Score: -1.20
References 1. Jain AD, Potteti H, Richardson BG, Kingsley L, Luciano JP, Ryuzoji AF, Lee H, Krunic A, Mesecar AD, Reddy SP, Moore TW.. (2015) Probing the structural requirements of non-electrophilic naphthalene-based Nrf2 activators., 103 [PMID:26363505 ] [10.1016/j.ejmech.2015.08.049 ]