The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N,N'-(1,4-Phenylene)bis(4-methoxybenzenesulfonamide) ID: ALA3632889
PubChem CID: 122194817
Max Phase: Preclinical
Molecular Formula: C26H22N2O4
Molecular Weight: 426.47
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C(=O)Nc2ccc(NC(=O)c3ccc(OC)cc3)c3ccccc23)cc1
Standard InChI: InChI=1S/C26H22N2O4/c1-31-19-11-7-17(8-12-19)25(29)27-23-15-16-24(22-6-4-3-5-21(22)23)28-26(30)18-9-13-20(32-2)14-10-18/h3-16H,1-2H3,(H,27,29)(H,28,30)
Standard InChI Key: YMLFKLVKNNNDCZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2995 2.9981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 3.7467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6034 5.2475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6385 3.1449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9025 5.9976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9025 7.4976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6035 8.2476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3044 7.4976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3044 5.9976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6004 9.7484 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5603 10.3470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2995 -2.9981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -3.7467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6034 -5.2475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6385 -3.1449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9025 -5.9976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9025 -7.4976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6035 -8.2476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3044 -7.4976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3044 -5.9976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6004 -9.7484 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5603 -10.3470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
10 11 1 0
11 12 1 0
12 13 1 0
12 14 2 0
13 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 13 1 0
17 20 1 0
20 21 1 0
7 22 1 0
22 23 1 0
23 24 1 0
23 25 2 0
24 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 24 1 0
28 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 426.47Molecular Weight (Monoisotopic): 426.1580AlogP: 5.36#Rotatable Bonds: 6Polar Surface Area: 76.66Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.83CX LogD: 4.83Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.44Np Likeness Score: -0.67
References 1. Jain AD, Potteti H, Richardson BG, Kingsley L, Luciano JP, Ryuzoji AF, Lee H, Krunic A, Mesecar AD, Reddy SP, Moore TW.. (2015) Probing the structural requirements of non-electrophilic naphthalene-based Nrf2 activators., 103 [PMID:26363505 ] [10.1016/j.ejmech.2015.08.049 ]