N,N'-(1,4-Phenylene)bis(4-methoxybenzenesulfonamide)

ID: ALA3632889

PubChem CID: 122194817

Max Phase: Preclinical

Molecular Formula: C26H22N2O4

Molecular Weight: 426.47

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(C(=O)Nc2ccc(NC(=O)c3ccc(OC)cc3)c3ccccc23)cc1

Standard InChI:  InChI=1S/C26H22N2O4/c1-31-19-11-7-17(8-12-19)25(29)27-23-15-16-24(22-6-4-3-5-21(22)23)28-26(30)18-9-13-20(32-2)14-10-18/h3-16H,1-2H3,(H,27,29)(H,28,30)

Standard InChI Key:  YMLFKLVKNNNDCZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   -2.6111    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2995    2.9981    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003    3.7467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6034    5.2475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6385    3.1449    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9025    5.9976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9025    7.4976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6035    8.2476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3044    7.4976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3044    5.9976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6004    9.7484    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5603   10.3470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2995   -2.9981    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -3.7467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6034   -5.2475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6385   -3.1449    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9025   -5.9976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9025   -7.4976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6035   -8.2476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3044   -7.4976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3044   -5.9976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6004   -9.7484    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5603  -10.3470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
 13 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 13  1  0
 17 20  1  0
 20 21  1  0
  7 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  2  0
 24 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 24  1  0
 28 31  1  0
 31 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3632889

    ---

Associated Targets(Human)

NFE2L2 Tchem Keap1/Nrf2 (1722 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 426.47Molecular Weight (Monoisotopic): 426.1580AlogP: 5.36#Rotatable Bonds: 6
Polar Surface Area: 76.66Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.83CX LogD: 4.83
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.44Np Likeness Score: -0.67

References

1. Jain AD, Potteti H, Richardson BG, Kingsley L, Luciano JP, Ryuzoji AF, Lee H, Krunic A, Mesecar AD, Reddy SP, Moore TW..  (2015)  Probing the structural requirements of non-electrophilic naphthalene-based Nrf2 activators.,  103  [PMID:26363505] [10.1016/j.ejmech.2015.08.049]

Source