methyl N-(6-[sphingosyl-N-carbonyl]hexyl)carbamate

ID: ALA3633584

PubChem CID: 122195380

Max Phase: Preclinical

Molecular Formula: C27H52N2O5

Molecular Weight: 484.72

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCCCC/C=C/[C@@H](O)[C@H](CO)NC(=O)CCCCCCNC(=O)OC

Standard InChI:  InChI=1S/C27H52N2O5/c1-3-4-5-6-7-8-9-10-11-12-13-14-17-20-25(31)24(23-30)29-26(32)21-18-15-16-19-22-28-27(33)34-2/h17,20,24-25,30-31H,3-16,18-19,21-23H2,1-2H3,(H,28,33)(H,29,32)/b20-17+/t24-,25+/m0/s1

Standard InChI Key:  KZWZVABQJBBMNV-PNIUMYDHSA-N

Molfile:  

     RDKit          2D

 34 33  0  0  0  0  0  0  0  0999 V2000
    9.0999    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7999    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5000    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9000    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3000    0.7500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6000   -1.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2606    0.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3999    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6999    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9999    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2999    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.9999   -1.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5999    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8999    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6030   -1.5008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6431   -2.0994    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.8999    1.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.1999    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4998    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7998    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0998    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3998    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6998    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9998    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2998    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5998    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8998    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1998    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4998    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7997    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0997    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1392    0.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  2  0
  7  9  1  0
  1 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
 15 13  1  6
 15 16  1  0
 15 17  1  0
 17 18  1  0
 16 19  1  6
 16 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3633584

    ---

Associated Targets(non-human)

Priestia megaterium (1154 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Escherichia coli (133304 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Wolbachia (153 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 484.72Molecular Weight (Monoisotopic): 484.3876AlogP: 5.39#Rotatable Bonds: 23
Polar Surface Area: 107.89Molecular Species: NEUTRALHBA: 5HBD: 4
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.42CX Basic pKa: CX LogP: 5.76CX LogD: 5.76
Aromatic Rings: Heavy Atoms: 34QED Weighted: 0.11Np Likeness Score: 0.77

References

1. Schäberle TF, Schmitz A, Zocher G, Schiefer A, Kehraus S, Neu E, Roth M, Vassylyev DG, Stehle T, Bierbaum G, Hoerauf A, Pfarr K, König GM..  (2015)  Insights into Structure-Activity Relationships of Bacterial RNA Polymerase Inhibiting Corallopyronin Derivatives.,  78  (10): [PMID:26431157] [10.1021/acs.jnatprod.5b00175]

Source