The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl N-(6-[sphingosyl-N-carbonyl]hexyl)carbamate ID: ALA3633584
PubChem CID: 122195380
Max Phase: Preclinical
Molecular Formula: C27H52N2O5
Molecular Weight: 484.72
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCCCCC/C=C/[C@@H](O)[C@H](CO)NC(=O)CCCCCCNC(=O)OC
Standard InChI: InChI=1S/C27H52N2O5/c1-3-4-5-6-7-8-9-10-11-12-13-14-17-20-25(31)24(23-30)29-26(32)21-18-15-16-19-22-28-27(33)34-2/h17,20,24-25,30-31H,3-16,18-19,21-23H2,1-2H3,(H,28,33)(H,29,32)/b20-17+/t24-,25+/m0/s1
Standard InChI Key: KZWZVABQJBBMNV-PNIUMYDHSA-N
Molfile:
RDKit 2D
34 33 0 0 0 0 0 0 0 0999 V2000
9.0999 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7999 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5000 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9000 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3000 0.7500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6000 -1.2000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2606 0.1503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3999 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6999 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9999 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2999 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9999 -1.2000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5999 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8999 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6030 -1.5008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6431 -2.0994 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8999 1.9500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1999 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4998 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7998 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0998 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3998 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6998 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9998 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2998 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5998 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8998 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1998 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4998 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7997 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0997 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1392 0.1503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
6 8 2 0
7 9 1 0
1 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
12 14 2 0
15 13 1 6
15 16 1 0
15 17 1 0
17 18 1 0
16 19 1 6
16 20 1 0
20 21 2 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 484.72Molecular Weight (Monoisotopic): 484.3876AlogP: 5.39#Rotatable Bonds: 23Polar Surface Area: 107.89Molecular Species: NEUTRALHBA: 5HBD: 4#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.42CX Basic pKa: ┄CX LogP: 5.76CX LogD: 5.76Aromatic Rings: ┄Heavy Atoms: 34QED Weighted: 0.11Np Likeness Score: 0.77
References 1. Schäberle TF, Schmitz A, Zocher G, Schiefer A, Kehraus S, Neu E, Roth M, Vassylyev DG, Stehle T, Bierbaum G, Hoerauf A, Pfarr K, König GM.. (2015) Insights into Structure-Activity Relationships of Bacterial RNA Polymerase Inhibiting Corallopyronin Derivatives., 78 (10): [PMID:26431157 ] [10.1021/acs.jnatprod.5b00175 ]