The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-pyridyl-cyanoguanidine derivative ID: ALA363430
PubChem CID: 10281586
Max Phase: Preclinical
Molecular Formula: C24H34Cl3N7O3
Molecular Weight: 503.03
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cl.N#CN/C(=N\CCCCCCOc1ccc(Cl)cc1)Nc1cc[n+](COC(=O)NCCCN)cc1.[Cl-]
Standard InChI: InChI=1S/C24H32ClN7O3.2ClH/c25-20-6-8-22(9-7-20)34-17-4-2-1-3-13-28-23(30-18-27)31-21-10-15-32(16-11-21)19-35-24(33)29-14-5-12-26;;/h6-11,15-16H,1-5,12-14,17,19,26H2,(H2,28,29,30,33);2*1H
Standard InChI Key: VIGGHMSBQOLPMS-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 36 0 0 0 0 0 0 0 0999 V2000
1.2929 -3.0716 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-0.0946 -3.0716 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
7.6191 -2.9896 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7398 -2.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0176 -3.3996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0571 -4.6200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7398 -2.9928 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3381 -4.2100 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4469 -3.7244 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3381 -3.3964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4557 -1.7692 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0145 -1.7723 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6342 -4.2952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6191 -2.1760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9032 -3.3964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1810 -2.1760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0571 -5.4336 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1810 -2.9896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9032 -1.7692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1788 -0.9650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7408 -1.7818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7591 -0.6370 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
10.4920 -7.7168 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4566 -0.5582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1788 -1.7818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7408 -0.9650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4566 -2.1854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7730 -6.6541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0186 -2.1854 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3050 -2.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7761 -5.8405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4920 -7.0640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3027 -1.7786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5828 -1.7723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4226 -2.1854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1385 -1.7754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8638 -2.1823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 11 1 0
5 7 1 0
6 8 1 0
7 4 1 0
8 10 1 0
9 5 3 0
10 3 1 0
11 16 1 0
12 4 2 0
13 6 2 0
3 14 2 0
15 3 1 0
16 18 1 0
17 6 1 0
18 15 2 0
19 14 1 0
20 25 2 0
21 29 1 0
22 20 1 0
23 32 1 0
24 26 2 0
25 27 1 0
26 21 1 0
27 21 2 0
28 31 1 0
29 33 1 0
30 12 1 0
31 17 1 0
32 28 1 0
33 35 1 0
34 30 1 0
35 36 1 0
36 37 1 0
37 34 1 0
19 16 2 0
24 20 1 0
M CHG 2 1 -1 3 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 503.03Molecular Weight (Monoisotopic): 502.2328AlogP: 3.14#Rotatable Bonds: 14Polar Surface Area: 137.67Molecular Species: BASEHBA: 6HBD: 4#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.89CX Basic pKa: 9.77CX LogP: -1.00CX LogD: -3.29Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.08Np Likeness Score: -0.62
References 1. Binderup E, Björkling F, Hjarnaa PV, Latini S, Baltzer B, Carlsen M, Binderup L.. (2005) EB1627: a soluble prodrug of the potent anticancer cyanoguanidine CHS828., 15 (10): [PMID:15863303 ] [10.1016/j.bmcl.2005.03.064 ]