(1S,3R,4R,6S,11R,12R,7E,)-1:12,3:4-diepoxycembr-7-ene-6,11-diol

ID: ALA3634659

PubChem CID: 122196280

Max Phase: Preclinical

Molecular Formula: C20H34O4

Molecular Weight: 338.49

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C/C1=C\[C@@H](O)C[C@@]2(C)O[C@@H]2C[C@]2(C(C)C)CC[C@@](C)(O2)[C@H](O)CC1

Standard InChI:  InChI=1S/C20H34O4/c1-13(2)20-9-8-18(4,24-20)16(22)7-6-14(3)10-15(21)11-19(5)17(12-20)23-19/h10,13,15-17,21-22H,6-9,11-12H2,1-5H3/b14-10+/t15-,16-,17-,18-,19-,20+/m1/s1

Standard InChI Key:  SMDIJQJOQYXYQB-ITZFYXQLSA-N

Molfile:  

     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
    2.2967    1.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3009   -1.5596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7699   -0.5092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4162   -1.1395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6009   -2.4312    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3007   -3.2172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6392    0.3740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2077    3.4447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6123    2.9525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2031   -3.2022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6194    0.3412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3575   -2.2699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5374   -0.8114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4251    0.2243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6085   -4.3316    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7996   -1.6586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7269   -0.8970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9958   -2.8425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6785   -2.5236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2274    2.9860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2344    1.8470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6583    3.3391    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1139    2.3230    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3729    2.6286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3963    3.8610    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  2  1  0
  4  7  1  0
  7 21  1  0
 20  8  1  0
  8  9  1  0
  9  1  1  0
  6 10  1  0
  1 11  2  0
 10 12  1  0
 11 13  1  0
 13 12  1  0
 11 14  1  0
 10 15  1  1
  4 16  1  1
 16 17  1  0
 16 18  1  0
  6 19  1  1
 21 20  1  0
 22 21  1  0
 20 22  1  0
 21 23  1  6
 20 24  1  1
  9 25  1  6
M  END

Alternative Forms

  1. Parent:

    ALA3634659

    ---

Associated Targets(non-human)

Xbp1 X-box-binding protein 1 (47 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 338.49Molecular Weight (Monoisotopic): 338.2457AlogP: 3.35#Rotatable Bonds: 1
Polar Surface Area: 62.22Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.93CX Basic pKa: CX LogP: 2.47CX LogD: 2.47
Aromatic Rings: Heavy Atoms: 24QED Weighted: 0.57Np Likeness Score: 3.10

References

1. Ren J, Wang YG, Wang AG, Wu LQ, Zhang HJ, Wang WJ, Su YL, Qin HL..  (2015)  Cembranoids from the Gum Resin of Boswellia carterii as Potential Antiulcerative Colitis Agents.,  78  (10): [PMID:26457560] [10.1021/acs.jnatprod.5b00104]

Source