The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(1-(3-(4-(1-(benzo[d]oxazol-2-yl)ethyl)phenoxy)propyl)piperidin-4-yl)-6-fluorobenzo[d]isoxazole ID: ALA3634825
PubChem CID: 122196385
Max Phase: Preclinical
Molecular Formula: C30H30FN3O3
Molecular Weight: 499.59
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(c1ccc(OCCCN2CCC(c3noc4cc(F)ccc34)CC2)cc1)c1nc2ccccc2o1
Standard InChI: InChI=1S/C30H30FN3O3/c1-20(30-32-26-5-2-3-6-27(26)36-30)21-7-10-24(11-8-21)35-18-4-15-34-16-13-22(14-17-34)29-25-12-9-23(31)19-28(25)37-33-29/h2-3,5-12,19-20,22H,4,13-18H2,1H3
Standard InChI Key: TVMSDNWCQAGRCR-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
1.7138 1.2033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3560 1.3452 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.3443 -5.3916 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8565 -5.2005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2781 -3.8165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1852 -2.6281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6753 -2.8147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2537 -4.1987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9258 -6.7752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4147 -6.9642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9963 -8.3478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4851 -8.5369 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0667 -9.9205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5545 -10.1116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1329 -11.4956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2235 -12.6885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7358 -12.4975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1573 -11.1135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7994 -14.0745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9894 -14.2294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3225 -16.6631 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8879 -15.2668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3996 -15.2160 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9087 -16.6264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1033 -17.5253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9368 -19.0201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5357 -19.6086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3411 -18.7096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5185 -17.2003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
1 5 1 0
6 7 1 0
7 8 2 0
8 9 1 0
4 9 2 0
5 6 2 0
7 10 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
11 16 1 0
17 18 1 0
18 19 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
21 26 2 0
20 21 1 0
27 28 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 1 0
29 33 1 0
34 35 1 0
35 36 2 0
36 37 1 0
32 37 2 0
33 34 2 0
27 30 1 0
24 27 1 0
19 20 1 0
11 17 1 0
3 14 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 499.59Molecular Weight (Monoisotopic): 499.2271AlogP: 6.91#Rotatable Bonds: 8Polar Surface Area: 64.53Molecular Species: BASEHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.73CX LogP: 5.67CX LogD: 4.32Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.22Np Likeness Score: -1.27
References 1. Huang L, Zhang W, Zhang X, Yin L, Chen B, Song J.. (2015) Synthesis and pharmacological evaluation of piperidine (piperazine)-substituted benzoxazole derivatives as multi-target antipsychotics., 25 (22): [PMID:26483200 ] [10.1016/j.bmcl.2015.09.045 ]