The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(4-Fluorophenyl)-5-[4-(quinolin-2-ylmethoxy)phenyl]-pyridin-2-yl acetate ID: ALA3634867
PubChem CID: 122196414
Max Phase: Preclinical
Molecular Formula: C29H21FN2O3
Molecular Weight: 464.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)Oc1ccc(-c2ccc(OCc3ccc4ccccc4n3)cc2)c(-c2ccc(F)cc2)n1
Standard InChI: InChI=1S/C29H21FN2O3/c1-19(33)35-28-17-16-26(29(32-28)22-6-11-23(30)12-7-22)20-9-14-25(15-10-20)34-18-24-13-8-21-4-2-3-5-27(21)31-24/h2-17H,18H2,1H3
Standard InChI Key: NMCWNZCOBPKTAG-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
-9.1024 6.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1046 7.5071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.4047 8.2552 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-11.7027 7.5033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.7005 6.0033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.4004 5.2552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8028 5.2564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5036 6.0062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2047 5.2560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2049 3.7560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5041 3.0062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8030 3.7564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9067 3.0027 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9091 1.5019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8060 8.2593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5046 7.5133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2079 8.2673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2124 9.7673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5137 10.5133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8105 9.7594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.0051 8.2492 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-14.3027 7.4951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.2988 6.2951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.3440 8.0914 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.1750 10.3704 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
1 7 1 0
10 13 1 0
13 14 1 0
14 15 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
2 16 1 0
15 22 2 0
22 23 1 0
23 26 2 0
25 24 2 0
24 15 1 0
25 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
4 31 1 0
31 32 1 0
32 33 1 0
32 34 2 0
19 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.50Molecular Weight (Monoisotopic): 464.1536AlogP: 6.61#Rotatable Bonds: 6Polar Surface Area: 61.31Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 3.25CX LogP: 6.59CX LogD: 6.59Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.26Np Likeness Score: -0.76
References 1. Lingam VS, Dahale DH, Rathi VE, Shingote YB, Thakur RR, Mindhe AS, Kummari S, Khairatkar-Joshi N, Bajpai M, Shah DM, Sapalya RS, Gullapalli S, Gupta PK, Gudi GS, Jadhav SB, Pattem R, Thomas A.. (2015) Design, Synthesis, and Pharmacological Evaluation of 5,6-Disubstituted Pyridin-2(1H)-one Derivatives as Phosphodiesterase 10A (PDE10A) Antagonists., 58 (20): [PMID:26421921 ] [10.1021/acs.jmedchem.5b01240 ]