US9034866, 465

ID: ALA3639388

PubChem CID: 89755223

Max Phase: Preclinical

Molecular Formula: C20H18FN3O5S

Molecular Weight: 431.45

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN1CC[C@@](O)(C#Cc2ccc3c(c2)-c2nc(C(N)=O)sc2[C@](O)(CF)CO3)C1=O

Standard InChI:  InChI=1S/C20H18FN3O5S/c1-24-7-6-19(27,18(24)26)5-4-11-2-3-13-12(8-11)14-15(20(28,9-21)10-29-13)30-17(23-14)16(22)25/h2-3,8,27-28H,6-7,9-10H2,1H3,(H2,22,25)/t19-,20-/m0/s1

Standard InChI Key:  PDRKYTNEGYCPFF-PMACEKPBSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  1  0  0  0  0  0999 V2000
    3.5635  -10.7916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6161   -9.5928    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4425   -8.6587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9681   -7.2538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4272   -7.3693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6141   -7.5458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8789   -5.9722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3306   -4.5751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7822   -3.1780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7175   -2.0053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1695   -0.6090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6852   -0.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3514    1.0778    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.7286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3515    1.0777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4543    0.6048    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0862    2.5289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0306    2.9678    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6852   -0.3847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0899   -0.9120    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0226   -2.4105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5767   -2.8095    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -1.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7500   -1.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -2.9545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1920   -3.3470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0115   -4.5334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3099   -2.9106    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8672   -8.7652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9983   -9.1659    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  6
  5  7  1  0
  7  8  3  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  1
 15 17  1  0
 17 18  1  0
 15 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 19  2  0
 23 24  1  0
 24 12  1  0
 24 25  2  0
 25  9  1  0
 21 26  1  0
 26 27  2  0
 26 28  1  0
  5 29  1  0
 29  2  1  0
 29 30  2  0
M  END

Associated Targets(Human)

MAP3K14 Tchem Mitogen-activated protein kinase kinase kinase 14 (1412 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 431.45Molecular Weight (Monoisotopic): 431.0951AlogP: 0.40#Rotatable Bonds: 2
Polar Surface Area: 125.98Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 10.93CX Basic pKa: CX LogP: 0.11CX LogD: 0.11
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.59Np Likeness Score: -0.19

References

1.  (2015)  Tricyclic compounds and methods of use therefor, 

Source

Source(1):