The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8748435, 39 ID: ALA3639746
PubChem CID: 86766090
Max Phase: Preclinical
Molecular Formula: C27H39N5
Molecular Weight: 433.64
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCc1nn2c(C)cc(C)nc2c1Cc1ccc(CCCN2CCN(C(C)C)CC2)cc1
Standard InChI: InChI=1S/C27H39N5/c1-6-26-25(27-28-21(4)18-22(5)32(27)29-26)19-24-11-9-23(10-12-24)8-7-13-30-14-16-31(17-15-30)20(2)3/h9-12,18,20H,6-8,13-17,19H2,1-5H3
Standard InChI Key: DFFKMCAWTADECS-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
3.7551 -4.4175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5551 -4.4192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3383 1.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3383 1.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6890 -4.0818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2234 -5.5086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2234 -6.6267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7552 -8.0517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7130 -8.3588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1844 -9.7837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6539 -10.0888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1253 -11.5137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5948 -11.8188 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0680 -13.2422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5373 -13.5442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5334 -12.4227 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0603 -10.9993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5910 -10.6973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0042 -12.7219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7998 -11.8236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3847 -13.8599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7131 -7.2408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2449 -5.8157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 7 1 0
6 8 2 0
8 9 1 0
9 10 1 0
9 11 2 0
11 12 1 0
12 5 1 0
12 13 2 0
13 3 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 22 1 0
25 28 1 0
28 29 1 0
28 30 1 0
18 31 1 0
31 32 2 0
32 15 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 433.64Molecular Weight (Monoisotopic): 433.3205AlogP: 4.46#Rotatable Bonds: 8Polar Surface Area: 36.67Molecular Species: BASEHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.66CX LogP: 5.20CX LogD: 3.92Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.53Np Likeness Score: -1.46
References 1. (2014) Pyrazolo pyrimidine derivatives, 2. Velcicky J, Miltz W, Oberhauser B, Orain D, Vaupel A, Weigand K, Dawson King J, Littlewood-Evans A, Nash M, Feifel R, Loetscher P.. (2017) Development of Selective, Orally Active GPR4 Antagonists with Modulatory Effects on Nociception, Inflammation, and Angiogenesis., 60 (9): [PMID:28445047 ] [10.1021/acs.jmedchem.6b01703 ]