The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8969394, 18 ID: ALA3639948
Cas Number: 1006036-89-0
PubChem CID: 24953281
Max Phase: Preclinical
Molecular Formula: C25H25F3N2O4S2
Molecular Weight: 538.61
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1sc(C)c(C(=O)N[C@@H](C)c2ccc(C(=O)NS(C)(=O)=O)cc2)c1Cc1ccc(C(F)(F)F)cc1
Standard InChI: InChI=1S/C25H25F3N2O4S2/c1-14(18-7-9-19(10-8-18)23(31)30-36(4,33)34)29-24(32)22-16(3)35-15(2)21(22)13-17-5-11-20(12-6-17)25(26,27)28/h5-12,14H,13H2,1-4H3,(H,29,32)(H,30,31)/t14-/m0/s1
Standard InChI Key: LRAMPOFRCGKEAQ-AWEZNQCLSA-N
Molfile:
RDKit 2D
36 38 0 0 1 0 0 0 0 0999 V2000
-2.6567 -2.2146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7546 -1.4232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3335 -1.9059 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0400 -3.3777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9421 -4.1691 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3786 -3.8595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8372 -5.2877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1285 -6.2561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3372 -5.2929 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.8056 -3.8679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9460 -3.4943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5988 1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5996 2.7004 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.6378 0.9001 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.6383 2.0999 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.0480 0.0486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9221 1.0398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2174 2.5105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6387 2.9901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7646 1.9990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4693 0.5283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9372 4.4609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0378 5.2553 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.3599 4.9387 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.6584 6.4096 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-5.7960 6.7916 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.8965 7.5857 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.7590 7.2040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
2 3 1 0
3 4 1 0
4 5 2 0
4 6 1 0
6 7 2 0
7 8 1 0
7 9 1 0
9 10 1 0
10 11 1 0
10 12 2 0
12 6 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
17 20 1 0
20 21 1 0
20 22 1 0
20 23 1 0
2 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
27 30 1 0
30 31 2 0
30 32 1 0
32 33 1 0
33 34 2 0
33 35 2 0
33 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 538.61Molecular Weight (Monoisotopic): 538.1208AlogP: 5.15#Rotatable Bonds: 7Polar Surface Area: 92.34Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.13CX Basic pKa: ┄CX LogP: 5.56CX LogD: 4.62Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.44Np Likeness Score: -1.03
References 1. (2015) Thiophenecarboxamide derivatives as EP4 receptor ligands,