US8969394, 18

ID: ALA3639948

Cas Number: 1006036-89-0

PubChem CID: 24953281

Max Phase: Preclinical

Molecular Formula: C25H25F3N2O4S2

Molecular Weight: 538.61

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1sc(C)c(C(=O)N[C@@H](C)c2ccc(C(=O)NS(C)(=O)=O)cc2)c1Cc1ccc(C(F)(F)F)cc1

Standard InChI:  InChI=1S/C25H25F3N2O4S2/c1-14(18-7-9-19(10-8-18)23(31)30-36(4,33)34)29-24(32)22-16(3)35-15(2)21(22)13-17-5-11-20(12-6-17)25(26,27)28/h5-12,14H,13H2,1-4H3,(H,29,32)(H,30,31)/t14-/m0/s1

Standard InChI Key:  LRAMPOFRCGKEAQ-AWEZNQCLSA-N

Molfile:  

     RDKit          2D

 36 38  0  0  1  0  0  0  0  0999 V2000
   -2.6567   -2.2146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7546   -1.4232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3335   -1.9059    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0400   -3.3777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9421   -4.1691    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3786   -3.8595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8372   -5.2877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1285   -6.2561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3372   -5.2929    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.8056   -3.8679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9460   -3.4943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5988    1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5996    2.7004    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6378    0.9001    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6383    2.0999    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0480    0.0486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9221    1.0398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2174    2.5105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6387    2.9901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7646    1.9990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4693    0.5283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9372    4.4609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0378    5.2553    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3599    4.9387    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6584    6.4096    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7960    6.7916    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8965    7.5857    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7590    7.2040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  1
  2  3  1  0
  3  4  1  0
  4  5  2  0
  4  6  1  0
  6  7  2  0
  7  8  1  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 10 12  2  0
 12  6  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 17 20  1  0
 20 21  1  0
 20 22  1  0
 20 23  1  0
  2 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 27 30  1  0
 30 31  2  0
 30 32  1  0
 32 33  1  0
 33 34  2  0
 33 35  2  0
 33 36  1  0
M  END

Associated Targets(Human)

PTGER4 Tclin Prostanoid EP4 receptor (2181 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 538.61Molecular Weight (Monoisotopic): 538.1208AlogP: 5.15#Rotatable Bonds: 7
Polar Surface Area: 92.34Molecular Species: ACIDHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.13CX Basic pKa: CX LogP: 5.56CX LogD: 4.62
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.44Np Likeness Score: -1.03

References

1.  (2015)  Thiophenecarboxamide derivatives as EP4 receptor ligands, 

Source

Source(1):