The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9062048, 41 ID: ALA3640029
PubChem CID: 54771067
Max Phase: Preclinical
Molecular Formula: C22H27F3N6O2
Molecular Weight: 464.49
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)N[C@H]1CC[C@@H](N2CC(NC(=O)CNc3ncnc4ccc(C(F)(F)F)cc34)C2)CC1
Standard InChI: InChI=1S/C22H27F3N6O2/c1-13(32)29-15-3-5-17(6-4-15)31-10-16(11-31)30-20(33)9-26-21-18-8-14(22(23,24)25)2-7-19(18)27-12-28-21/h2,7-8,12,15-17H,3-6,9-11H2,1H3,(H,29,32)(H,30,33)(H,26,27,28)/t15-,17+
Standard InChI Key: AZQQEUJRDLWUNT-WOVMCDHWSA-N
Molfile:
RDKit 2D
33 36 0 0 1 0 0 0 0 0999 V2000
12.8844 -8.0800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0170 -7.6837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9264 -8.4667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2956 -6.2089 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1583 -5.2296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4345 -3.7552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2959 -2.7788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8923 -3.2739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6046 -4.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7433 -5.7275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5926 -2.5235 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2044 -1.0746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8003 -1.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1437 -2.9117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4990 -0.7409 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2024 -2.6932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -5.2508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3379 -5.8515 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.2596 -5.8505 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.2984 -6.4508 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
5 4 1 1
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 5 1 0
8 11 1 1
11 12 1 0
12 13 1 0
13 14 1 0
14 11 1 0
13 15 1 0
15 16 1 0
16 17 2 0
16 18 1 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 20 1 0
29 24 1 0
27 30 1 0
30 31 1 0
30 32 1 0
30 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.49Molecular Weight (Monoisotopic): 464.2148AlogP: 2.31#Rotatable Bonds: 6Polar Surface Area: 99.25Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.49CX Basic pKa: 7.43CX LogP: 1.30CX LogD: 0.98Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.61Np Likeness Score: -1.42
References 1. (2015) Cyclohexyl-azetidinyl antagonists of CCR2,