The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-3-(3-Hydroxy-4-methoxy-phenyl)-2-methoxy-1-(3,4,5-trimethoxy-phenyl)-propenone ID: ALA364034
PubChem CID: 10215785
Max Phase: Preclinical
Molecular Formula: C20H22O7
Molecular Weight: 374.39
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CO/C(=C\c1ccc(OC)c(O)c1)C(=O)c1cc(OC)c(OC)c(OC)c1
Standard InChI: InChI=1S/C20H22O7/c1-23-15-7-6-12(8-14(15)21)9-16(24-2)19(22)13-10-17(25-3)20(27-5)18(11-13)26-4/h6-11,21H,1-5H3/b16-9-
Standard InChI Key: FNILUMSXQRNRNV-SXGWCWSVSA-N
Molfile:
RDKit 2D
27 28 0 0 0 0 0 0 0 0999 V2000
-2.9973 0.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9984 0.0518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2836 -0.3610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5672 0.0523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5700 0.8828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2854 1.2920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8571 1.2980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1411 0.8882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8602 2.1230 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1380 0.0632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5780 -0.3466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5795 -1.1719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2947 -1.5816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0086 -1.1664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0028 -0.3371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2870 0.0689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7118 1.2915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.7120 2.1165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7132 -0.3601 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.4274 0.0530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2838 -1.1860 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9984 -1.5984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7142 0.0806 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7251 -1.5752 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7293 -2.4002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5718 1.3034 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5687 2.1284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
13 14 2 0
5 7 1 0
14 15 1 0
3 4 2 0
15 16 2 0
16 11 1 0
7 8 1 0
1 17 1 0
17 18 1 0
7 9 2 0
2 19 1 0
4 5 1 0
19 20 1 0
8 10 2 0
3 21 1 0
2 3 1 0
21 22 1 0
10 11 1 0
15 23 1 0
5 6 2 0
14 24 1 0
11 12 2 0
24 25 1 0
6 1 1 0
8 26 1 0
12 13 1 0
26 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 374.39Molecular Weight (Monoisotopic): 374.1366AlogP: 3.30#Rotatable Bonds: 8Polar Surface Area: 83.45Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.76CX Basic pKa: ┄CX LogP: 2.55CX LogD: 2.55Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.43Np Likeness Score: 0.61
References 1. Ducki S, Mackenzie G, Lawrence NJ, Snyder JP.. (2005) Quantitative structure-activity relationship (5D-QSAR) study of combretastatin-like analogues as inhibitors of tubulin assembly., 48 (2): [PMID:15658859 ] [10.1021/jm049444m ] 2. Ducki S, Rennison D, Woo M, Kendall A, Chabert JF, McGown AT, Lawrence NJ.. (2009) Combretastatin-like chalcones as inhibitors of microtubule polymerization. Part 1: synthesis and biological evaluation of antivascular activity., 17 (22): [PMID:19837593 ] [10.1016/j.bmc.2009.09.039 ]