US8802673, 209

ID: ALA3641759

PubChem CID: 68325763

Max Phase: Preclinical

Molecular Formula: C16H15F5N4O2

Molecular Weight: 390.31

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Fc1cc(Nc2ncc(F)c(OCC(F)(F)F)n2)ccc1C1CNCCO1

Standard InChI:  InChI=1S/C16H15F5N4O2/c17-11-5-9(1-2-10(11)13-7-22-3-4-26-13)24-15-23-6-12(18)14(25-15)27-8-16(19,20)21/h1-2,5-6,13,22H,3-4,7-8H2,(H,23,24,25)

Standard InChI Key:  ALNGRRMJEIRAFV-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
    2.3383   -1.3500    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6003    1.4977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8990    0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2007    1.4909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4972    0.7364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4920   -0.7636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7890   -1.5185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0920   -0.7751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3872   -1.5316    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3796   -3.0316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0768   -3.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7816   -3.0185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1903   -1.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1862   -2.7091    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8939   -0.7546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0031   -3.0008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3039   -3.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3070   -5.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3471   -5.8487    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2688   -5.8520    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3089   -6.4502    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 11  1  0
 10 17  1  0
 17 18  1  0
 17 19  2  0
 19  7  1  0
  5 20  1  0
 20 21  2  0
 21  2  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  1  0
 24 27  1  0
M  END

Associated Targets(non-human)

Taar1 Trace amine-associated receptor 1 (1619 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Taar7b Trace amine-associated receptor 7b (211 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 390.31Molecular Weight (Monoisotopic): 390.1115AlogP: 3.10#Rotatable Bonds: 5
Polar Surface Area: 68.30Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.59CX Basic pKa: 7.93CX LogP: 3.25CX LogD: 2.61
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.77Np Likeness Score: -1.37

References

1.  (2014)  Heterocyclic amine derivatives, 

Source

Source(1):