US8470816, 82

ID: ALA3642162

PubChem CID: 71699792

Max Phase: Preclinical

Molecular Formula: C29H28Cl2F6N2O3

Molecular Weight: 637.45

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)C1CCC(C(=O)N2CC(c3ccc(Cl)c(Cl)c3)[C@H](N(C)C(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)C2)CC1

Standard InChI:  InChI=1S/C29H28Cl2F6N2O3/c1-15(40)16-3-5-17(6-4-16)27(42)39-13-22(18-7-8-23(30)24(31)11-18)25(14-39)38(2)26(41)19-9-20(28(32,33)34)12-21(10-19)29(35,36)37/h7-12,16-17,22,25H,3-6,13-14H2,1-2H3/t16?,17?,22?,25-/m1/s1

Standard InChI Key:  CCRJBODRXVWELY-TYHVNVTKSA-N

Molfile:  

     RDKit          2D

 42 45  0  0  1  0  0  0  0  0999 V2000
    3.3615    1.3842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2567    0.5852    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9511   -0.8815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9531   -1.9978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2010   -3.2956    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7343   -2.9815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5987   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383    1.3500    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383   -1.3500    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8054   -4.6666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9984   -4.7960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9195   -5.8781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5226   -7.2516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6348   -8.4606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1438   -8.2963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5407   -6.9229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4285   -5.7138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2531   -9.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0605   -9.3710    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7337  -10.6037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6819    1.0557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5772    0.2566    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9880    2.5249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4118    2.9972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7147    4.4663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5939    5.4632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1702    4.9910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8672    3.5219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0487    5.9885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2903    7.1639    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.9099    5.6103    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.1517    6.7856    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.1392    4.9388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0364    4.1418    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.3812    6.1141    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.2780    5.3171    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  6
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  3  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 11 13  1  0
 13 14  1  0
 13 15  2  0
 15  8  1  0
  5 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 18  1  0
 21 24  1  0
 24 25  2  0
 24 26  1  0
  2 27  1  0
 27 28  2  0
 27 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 33 35  1  0
 35 36  1  0
 35 37  1  0
 35 38  1  0
 31 39  1  0
 39 40  1  0
 39 41  1  0
 39 42  1  0
M  END

Associated Targets(Human)

TACR2 Tchem Neurokinin 2 receptor (3341 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TACR1 Tclin Neurokinin 1 receptor (6273 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 637.45Molecular Weight (Monoisotopic): 636.1381AlogP: 7.49#Rotatable Bonds: 5
Polar Surface Area: 57.69Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 6.71CX LogD: 6.71
Aromatic Rings: 2Heavy Atoms: 42QED Weighted: 0.32Np Likeness Score: -0.84

References

1.  (2013)  Nitrogen-containing heterocyclic compound and use thereof, 

Source

Source(1):