US8470816, 251a

ID: ALA3642164

PubChem CID: 68870105

Max Phase: Preclinical

Molecular Formula: C27H30Cl3N3O3

Molecular Weight: 550.91

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)N1CCC(C(=O)N2CC[C@@H](N(C)C(=O)c3ccc(Cl)cc3)[C@H](c3ccc(Cl)c(Cl)c3)C2)CC1

Standard InChI:  InChI=1S/C27H30Cl3N3O3/c1-17(34)32-12-9-19(10-13-32)27(36)33-14-11-25(22(16-33)20-5-8-23(29)24(30)15-20)31(2)26(35)18-3-6-21(28)7-4-18/h3-8,15,19,22,25H,9-14,16H2,1-2H3/t22-,25+/m0/s1

Standard InChI Key:  RPTJPWCOBZLMMD-WIOPSUGQSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  1  0  0  0  0  0999 V2000
    2.6024   -2.6977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2979   -3.7529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2955   -5.2529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0047   -6.0009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0066   -7.2009    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -1.3026   -5.2488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3428   -5.8472    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -1.3002   -3.7488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6003    1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6024    2.6977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8990    0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2007    1.4909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4972    0.7364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4920   -0.7636    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1903   -1.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8939   -0.7546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7876   -1.5212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7817   -2.7212    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8299   -0.9266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8969    0.4545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2003   -1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4994   -0.7432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7985   -1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7985   -2.9932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8378   -3.5932    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    6.4995   -3.7432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2004   -2.9933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  1
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  3  1  0
  8  9  1  6
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 12 14  1  0
 14 15  1  0
 14 16  2  0
 16  9  1  0
  6 17  1  0
 17 18  2  0
 17 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 19  1  0
 22 25  1  0
 25 26  2  0
 25 27  1  0
  2 28  1  0
 28 29  2  0
 28 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 33 35  1  0
 35 36  2  0
 36 30  1  0
M  END

Associated Targets(Human)

TACR2 Tchem Neurokinin 2 receptor (3341 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TACR1 Tclin Neurokinin 1 receptor (6273 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 550.91Molecular Weight (Monoisotopic): 549.1353AlogP: 5.36#Rotatable Bonds: 4
Polar Surface Area: 60.93Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 3.66CX LogD: 3.66
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.51Np Likeness Score: -1.20

References

1.  (2013)  Nitrogen-containing heterocyclic compound and use thereof, 

Source

Source(1):