US8470816, 268

ID: ALA3642167

Cas Number: 1160253-76-8

PubChem CID: 68869786

Max Phase: Preclinical

Molecular Formula: C31H38Cl2N4O4

Molecular Weight: 601.58

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)N1CCC(C(=O)N2CC[C@@H](N(C)C(=O)c3ccc(N4CCOCC4)cc3)[C@H](c3ccc(Cl)c(Cl)c3)C2)CC1

Standard InChI:  InChI=1S/C31H38Cl2N4O4/c1-21(38)35-12-9-23(10-13-35)31(40)37-14-11-29(26(20-37)24-5-8-27(32)28(33)19-24)34(2)30(39)22-3-6-25(7-4-22)36-15-17-41-18-16-36/h3-8,19,23,26,29H,9-18,20H2,1-2H3/t26-,29+/m0/s1

Standard InChI Key:  HBSNGWZAWTZUKT-LITSAYRRSA-N

Molfile:  

     RDKit          2D

 41 45  0  0  1  0  0  0  0  0999 V2000
    2.6024   -2.6977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2979   -3.7529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2955   -5.2529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0047   -6.0009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0066   -7.2009    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -1.3026   -5.2488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3428   -5.8472    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -1.3002   -3.7488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6003    1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6024    2.6977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8990    0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2007    1.4909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4972    0.7364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4920   -0.7636    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1903   -1.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8939   -0.7546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7876   -1.5212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7817   -2.7212    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8299   -0.9266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8969    0.4545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2003   -1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4994   -0.7432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7985   -1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7985   -2.9932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4995   -3.7432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2004   -2.9933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0982   -3.7435    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3985   -2.9956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6964   -3.7477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6940   -5.2477    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3938   -5.9956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0960   -5.2436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  1
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  3  1  0
  8  9  1  6
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 12 14  1  0
 14 15  1  0
 14 16  2  0
 16  9  1  0
  6 17  1  0
 17 18  2  0
 17 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 19  1  0
 22 25  1  0
 25 26  2  0
 25 27  1  0
  2 28  1  0
 28 29  2  0
 28 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 33 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 36  1  0
M  END

Associated Targets(Human)

TACR2 Tchem Neurokinin 2 receptor (3341 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 601.58Molecular Weight (Monoisotopic): 600.2270AlogP: 4.55#Rotatable Bonds: 5
Polar Surface Area: 73.40Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 0.21CX LogP: 2.95CX LogD: 2.95
Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.50Np Likeness Score: -1.36

References

1.  (2013)  Nitrogen-containing heterocyclic compound and use thereof, 

Source

Source(1):