The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8470816, 458 ID: ALA3642170
PubChem CID: 68932311
Max Phase: Preclinical
Molecular Formula: C27H30Cl3N3O4
Molecular Weight: 566.91
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN(C(=O)c1ccc(Cl)cc1)[C@@H]1CCN(C(=O)C2CCN(C(=O)CO)CC2)C[C@H]1c1ccc(Cl)c(Cl)c1
Standard InChI: InChI=1S/C27H30Cl3N3O4/c1-31(26(36)17-2-5-20(28)6-3-17)24-10-13-33(15-21(24)19-4-7-22(29)23(30)14-19)27(37)18-8-11-32(12-9-18)25(35)16-34/h2-7,14,18,21,24,34H,8-13,15-16H2,1H3/t21-,24+/m0/s1
Standard InChI Key: JCJPMSLGXSUYHY-XUZZJYLKSA-N
Molfile:
RDKit 2D
37 40 0 0 1 0 0 0 0 0999 V2000
2.6024 -2.6977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2979 -3.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2955 -5.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0047 -6.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0066 -7.2009 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.3026 -5.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3428 -5.8472 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.3002 -3.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6024 2.6977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2007 1.4909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4972 0.7364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4920 -0.7636 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.1903 -1.5091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8939 -0.7546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7876 -1.5212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8299 -0.9266 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.7802 -3.0220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8161 -3.6277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8969 0.4545 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4994 -0.7432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7985 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7985 -2.9932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8378 -3.5932 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6.4995 -3.7432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2004 -2.9933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 1
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 3 1 0
8 9 1 6
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
12 14 1 0
14 15 1 0
14 16 2 0
16 9 1 0
6 17 1 0
17 18 2 0
17 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 19 1 0
22 25 1 0
25 26 2 0
25 27 1 0
27 28 1 0
2 29 1 0
29 30 2 0
29 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
34 36 1 0
36 37 2 0
37 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 566.91Molecular Weight (Monoisotopic): 565.1302AlogP: 4.33#Rotatable Bonds: 5Polar Surface Area: 81.16Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.63CX Basic pKa: ┄CX LogP: 2.85CX LogD: 2.85Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.58Np Likeness Score: -1.07
References 1. (2013) Nitrogen-containing heterocyclic compound and use thereof,