US8853207, Example-10

ID: ALA3644446

PubChem CID: 90684347

Max Phase: Preclinical

Molecular Formula: C21H16N2OS

Molecular Weight: 344.44

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Oc1cccc(Cc2ccc(-c3n[nH]c4c3Cc3sccc3-4)cc2)c1

Standard InChI:  InChI=1S/C21H16N2OS/c24-16-3-1-2-14(11-16)10-13-4-6-15(7-5-13)20-18-12-19-17(8-9-25-19)21(18)23-22-20/h1-9,11,24H,10,12H2,(H,22,23)

Standard InChI Key:  WLPCSWGMHOFCEM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 25 29  0  0  0  0  0  0  0  0999 V2000
   -0.1404   -8.7857    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0592   -8.7546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8427  -10.0337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3421   -9.9948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0582   -8.6767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2748   -7.3975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9886   -6.0773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2029   -4.7985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9144   -3.4780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1265   -2.2016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6321   -2.2464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9157   -3.5662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7035   -4.8426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7500   -1.0323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2135    0.3943    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.2760    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2135    0.3943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -1.0323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9615   -1.9133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1750   -1.0316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6731   -1.0323    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1366    0.3943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9231    1.2760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7115    0.3949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7752   -7.4365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
 11 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 14  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 17  1  0
 24 20  2  0
  6 25  2  0
 25  2  1  0
M  END

Associated Targets(Human)

PDGFRB Tclin Platelet-derived growth factor receptor beta (5195 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
KIT Tclin Stem cell growth factor receptor (10667 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 344.44Molecular Weight (Monoisotopic): 344.0983AlogP: 5.01#Rotatable Bonds: 3
Polar Surface Area: 48.91Molecular Species: ACIDHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 1.96CX Basic pKa: 3.46CX LogP: 5.14CX LogD: 2.29
Aromatic Rings: 4Heavy Atoms: 25QED Weighted: 0.48Np Likeness Score: -0.64

References

1.  (2014)  Heterocyclic pyrazole compounds, method for preparing the same and use thereof, 

Source

Source(1):