The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8853207, Example-82 ID: ALA3644450
PubChem CID: 71815241
Max Phase: Preclinical
Molecular Formula: C26H25N5O2S
Molecular Weight: 471.59
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2n[nH]c3c2Cc2sc(-c4ccc(NC(=O)CN5CCCC5)nc4)cc2-3)cc1
Standard InChI: InChI=1S/C26H25N5O2S/c1-33-18-7-4-16(5-8-18)25-20-13-22-19(26(20)30-29-25)12-21(34-22)17-6-9-23(27-14-17)28-24(32)15-31-10-2-3-11-31/h4-9,12,14H,2-3,10-11,13,15H2,1H3,(H,29,30)(H,27,28,32)
Standard InChI Key: OZSJPXRPIQKJRS-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 39 0 0 0 0 0 0 0 0999 V2000
3.4179 -7.1329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9886 -6.0773 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2029 -4.7985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9144 -3.4780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1265 -2.2016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6321 -2.2464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9157 -3.5662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7035 -4.8426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2135 0.3943 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.2760 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9615 -1.9133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1750 -1.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6731 -1.0323 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-5.1366 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9231 1.2760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7115 0.3949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5639 0.8580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7465 -0.0566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1341 0.5129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.3347 1.9995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.7220 2.5722 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-10.9206 4.0598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.9696 4.7918 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-12.3078 4.6325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.5064 6.1202 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-13.8216 6.8146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.5479 8.2894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.0606 8.4848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.4152 7.1308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.1477 2.9164 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.7600 2.3469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
6 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
12 13 2 0
13 9 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 12 1 0
19 15 2 0
17 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 1 0
25 26 2 0
25 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 28 1 0
23 33 1 0
33 34 2 0
34 20 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 471.59Molecular Weight (Monoisotopic): 471.1729AlogP: 4.81#Rotatable Bonds: 6Polar Surface Area: 83.14Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 1.26CX Basic pKa: 7.44CX LogP: 0.87CX LogD: 0.91Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.37Np Likeness Score: -1.57
References 1. (2014) Heterocyclic pyrazole compounds, method for preparing the same and use thereof,