The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8476255, 33 ID: ALA3644951
PubChem CID: 25265170
Max Phase: Preclinical
Molecular Formula: C31H26ClN3O4
Molecular Weight: 540.02
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1ccc(/C=C(/C(=O)NCc2ccc(C(=O)Nc3ccccc3N)cc2)c2cccc(Cl)c2)cc1
Standard InChI: InChI=1S/C31H26ClN3O4/c1-39-31(38)23-15-9-20(10-16-23)17-26(24-5-4-6-25(32)18-24)30(37)34-19-21-11-13-22(14-12-21)29(36)35-28-8-3-2-7-27(28)33/h2-18H,19,33H2,1H3,(H,34,37)(H,35,36)/b26-17+
Standard InChI Key: VSNSPFPIZNAZQJ-YZSQISJMSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
3.6331 -3.6060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6375 -0.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2003 1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2024 2.6932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4990 0.7409 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.8003 1.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0990 0.7364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.4007 1.4818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6971 0.7273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6919 -0.7727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3903 -1.5182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0939 -0.7637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9875 -1.5302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.0299 -0.9357 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-12.9802 -3.0311 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-14.2758 -3.7886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.5775 -3.0432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-16.8739 -3.7977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-16.8687 -5.2977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.5670 -6.0432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.2706 -5.2887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.2293 -5.8851 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8964 -0.7553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1931 -1.5094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1885 -3.0094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8871 -3.7554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5904 -3.0014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5493 -3.5981 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-2.5951 -1.5014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
3 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
11 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
18 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
29 30 1 0
10 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 1 0
35 37 2 0
37 31 1 0
8 38 1 0
38 39 2 0
39 5 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 540.02Molecular Weight (Monoisotopic): 539.1612AlogP: 5.82#Rotatable Bonds: 8Polar Surface Area: 110.52Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 3.27CX LogP: 5.82CX LogD: 5.82Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.11Np Likeness Score: -0.90
References 1. (2013) Histone deacetylase inhibitors,