The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8476255, 52 ID: ALA3644954
PubChem CID: 25265746
Max Phase: Preclinical
Molecular Formula: C24H21FN2O3S
Molecular Weight: 436.51
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CSc1ccc(/C=C(/C(=O)NCc2ccc(C(=O)NO)cc2)c2ccc(F)cc2)cc1
Standard InChI: InChI=1S/C24H21FN2O3S/c1-31-21-12-4-16(5-13-21)14-22(18-8-10-20(25)11-9-18)24(29)26-15-17-2-6-19(7-3-17)23(28)27-30/h2-14,30H,15H2,1H3,(H,26,29)(H,27,28)/b22-14+
Standard InChI Key: PHLPWHKCJXUCTB-HYARGMPZSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
2.5956 -2.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2003 1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2024 2.6932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4990 0.7409 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.8003 1.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0990 0.7364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.4007 1.4818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6971 0.7273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6919 -0.7727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3903 -1.5182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0939 -0.7637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9875 -1.5302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.0299 -0.9357 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-12.9802 -3.0311 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-14.0161 -3.6368 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8964 -0.7553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1931 -1.5094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1885 -3.0094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8871 -3.7554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8834 -4.9554 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.5904 -3.0014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5951 -1.5014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
9 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
16 19 1 0
19 20 2 0
19 21 1 0
21 22 1 0
8 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
26 28 1 0
28 29 2 0
29 23 1 0
6 30 1 0
30 31 2 0
31 3 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 436.51Molecular Weight (Monoisotopic): 436.1257AlogP: 4.52#Rotatable Bonds: 7Polar Surface Area: 78.43Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.05CX Basic pKa: ┄CX LogP: 4.56CX LogD: 4.55Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.17Np Likeness Score: -1.11
References 1. (2013) Histone deacetylase inhibitors,