(S)-3-(1-Methyl-1H-imidazol-4-yl)-acrylic acid (4R,5S,14S,15R)-11-(3-acetoxy-4,5-dihydroxy-tetrahydro-pyran-2-yloxymethyl)-8-isopropyl-12-methoxy-1-methyl-5-(R)-methyl-15-oxa-tricyclo[10.2.1.0*4,9*]pentadeca-5,10,13-trien-2-yl ester

ID: ALA364675

PubChem CID: 21774715

Max Phase: Preclinical

Molecular Formula: C35H48N2O10

Molecular Weight: 656.77

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CO[C@]12C=C[C@](C)(O1)[C@@H](OC(=O)/C=C/c1cn(C)cn1)C[C@H]1C(C)=CC[C@H](C(C)C)[C@H]1/C=C\2COC1OCC(O)C(O)C1OC(C)=O

Standard InChI:  InChI=1S/C35H48N2O10/c1-20(2)25-10-8-21(3)26-15-29(46-30(40)11-9-24-16-37(6)19-36-24)34(5)12-13-35(42-7,47-34)23(14-27(25)26)17-43-33-32(45-22(4)38)31(41)28(39)18-44-33/h8-9,11-14,16,19-20,25-29,31-33,39,41H,10,15,17-18H2,1-7H3/b11-9+,23-14-/t25-,26+,27-,28?,29+,31?,32?,33?,34+,35-/m1/s1

Standard InChI Key:  XOPYFXBZMVTEJF-JLQYLIJZSA-N

Molfile:  

     RDKit          2D

 49 53  0  0  1  0  0  0  0  0999 V2000
    5.5500   -1.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8625   -1.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2625   -1.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9292   -4.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7417   -1.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8375   -0.6250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5250   -0.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2625   -0.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1500   -4.1125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2917    1.6708    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8000    0.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2667   -3.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5500   -1.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9792    0.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0250   -1.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0500   -0.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5500    0.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9667    0.3708    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6042    0.8958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4750    1.6083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5292   -4.8917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8792   -3.5667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8375   -0.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2667    0.8083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8375   -1.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3792    1.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4792   -5.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8000    1.0500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7625    2.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1792    1.4333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8625   -2.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5750   -3.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2667   -3.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8417   -4.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3417    2.3833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3167   -3.4792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9875   -2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9542   -4.2792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5500   -2.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3042   -5.9542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9250    0.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9625   -0.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5500    1.0583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7750   -2.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2667   -2.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8375   -2.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8125   -2.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2542    0.6375    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2542   -1.8375    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  5  1  0
  4 12  1  0
  5  2  2  0
  6  1  1  0
  7  6  1  0
  8  3  1  0
  9  4  1  0
 10 20  1  0
 11  7  1  0
 12 33  1  0
 13  3  1  0
 14 11  1  0
 15  1  1  0
 16 15  2  0
 17  8  1  0
 18 24  1  0
 19 10  2  0
 20 29  1  0
 21 12  1  0
 22  4  1  0
 23 25  1  0
 24 20  2  0
 25 13  1  0
 26 28  1  0
 27 34  1  0
 11 28  1  6
 29 30  2  0
 30 26  1  0
 31  2  1  0
 32 22  1  0
 33 31  1  0
 34 21  1  0
 35 26  2  0
 36 32  2  0
  1 37  1  1
 38  9  1  0
 13 39  1  1
 40 27  1  0
  7 41  1  1
 42 18  1  0
 43 17  1  0
 44 32  1  0
 45 39  1  0
 46 39  1  0
 47 37  1  0
  8 48  1  1
  3 49  1  1
 16  7  1  0
 14  8  1  0
 23 17  2  0
  9 27  1  0
 19 18  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA364675

   [(1S,2S,4R,8R,9S,10Z,12R)-11-[(3-acetyloxy-4,5-dihydroxyoxan-2-yl)oxymethyl]-12-methoxy-1,5-dimethyl-8-propan-2-yl-15-oxatricyclo[10.2.1.04,9]pentadeca-5,10,13-trien-2-yl] (E)-3-(1-methylimidazol-4-yl)prop-2-enoate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 656.77

Molecular Weight (Monoisotopic): 656.3309

AlogP: 3.24

#Rotatable Bonds: 9

Polar Surface Area: 147.80

Molecular Species: NEUTRAL

HBA: 12

HBD: 2

#RO5 Violations: 2

HBA (Lipinski): 12

HBD (Lipinski): 2

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 12.81

CX Basic pKa: 5.70

CX LogP: 3.77

CX LogD: 3.76

Aromatic Rings: 1

Heavy Atoms: 47

QED Weighted: 0.23

Np Likeness Score: 2.48

References

1. Nicolaou KC..  (2005)  Joys of molecules. 2. Endeavors in chemical biology and medicinal chemistry.,  48  (18): [PMID:16134928] [10.1021/jm050524f]

2. Nicolaou KC..  (2005)  Joys of molecules. 2. Endeavors in chemical biology and medicinal chemistry.,  48  (18): [PMID:16134928] [10.1021/jm050524f]

3. Nicolaou KC..  (2005)  Joys of molecules. 2. Endeavors in chemical biology and medicinal chemistry.,  48  (18): [PMID:16134928] [10.1021/jm050524f]

4. Nicolaou KC..  (2005)  Joys of molecules. 2. Endeavors in chemical biology and medicinal chemistry.,  48  (18): [PMID:16134928] [10.1021/jm050524f]

Source

Source(1):

• Scientific Literature