The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8802724, 3a ID: ALA3646783
PubChem CID: 23545474
Max Phase: Preclinical
Molecular Formula: C28H38N2O8S
Molecular Weight: 562.69
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(S(=O)(=O)N(CC(C)C)CC(O)C(Cc2ccccc2)NC(=O)OC2COC3OCCC23)cc1
Standard InChI: InChI=1S/C28H38N2O8S/c1-19(2)16-30(39(33,34)22-11-9-21(35-3)10-12-22)17-25(31)24(15-20-7-5-4-6-8-20)29-28(32)38-26-18-37-27-23(26)13-14-36-27/h4-12,19,23-27,31H,13-18H2,1-3H3,(H,29,32)
Standard InChI Key: BINXAIIXOUQUKC-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
14.9900 -9.9601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7970 -10.0898 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9098 -8.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4184 -9.0391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5342 -7.8274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1414 -6.4558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6329 -6.2960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5171 -7.5076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2567 -5.2435 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.7429 -4.1464 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5498 -4.2738 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7644 -5.4025 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1535 -6.7734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6610 -6.9308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1725 -8.0269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9556 -5.9600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8797 -4.1902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3873 -4.3492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9011 -5.4463 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5026 -3.1368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1078 -1.7634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2218 -0.5521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8247 0.8215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9367 2.0304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4457 1.8658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8428 0.4923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7308 -0.7166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0102 -3.2959 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1255 -2.0835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6117 -0.9864 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6332 -2.2426 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.2760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7115 0.3949 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1750 -1.0317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9615 -1.9133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
6 9 1 0
9 10 2 0
9 11 2 0
9 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
14 16 1 0
12 17 1 0
17 18 1 0
18 19 1 0
18 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
20 28 1 0
28 29 1 0
29 30 2 0
29 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 32 1 0
39 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 562.69Molecular Weight (Monoisotopic): 562.2349AlogP: 2.80#Rotatable Bonds: 12Polar Surface Area: 123.63Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.49CX Basic pKa: ┄CX LogP: 3.49CX LogD: 3.49Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.40Np Likeness Score: 0.08
References 1. (2014) Processes and intermediates for preparing substituted hexahydrofuro [2,3-b] furans,