The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8802724, 23a::US8802724, 23c ID: ALA3646784
PubChem CID: 75966822
Max Phase: Preclinical
Molecular Formula: C29H40N2O9S
Molecular Weight: 592.71
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(S(=O)(=O)N(CC(C)C)CC(O)C(Cc2ccccc2)NC(=O)OC2COC3OCC(OC)C23)cc1
Standard InChI: InChI=1S/C29H40N2O9S/c1-19(2)15-31(41(34,35)22-12-10-21(36-3)11-13-22)16-24(32)23(14-20-8-6-5-7-9-20)30-29(33)40-26-18-39-28-27(26)25(37-4)17-38-28/h5-13,19,23-28,32H,14-18H2,1-4H3,(H,30,33)
Standard InChI Key: YOBNNQXGIZIFRK-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
2.8264 -2.1154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6332 -2.2426 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.2760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2135 0.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7115 0.3949 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1750 -1.0317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9615 -1.9133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9639 -3.4116 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2643 -4.1608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3028 -3.5595 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2667 -5.6616 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.5671 -6.4108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8644 -5.6561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8604 -4.1553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.1559 -3.3990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.1488 -1.8991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8462 -1.1552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5508 -1.9113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5578 -3.4113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5695 -7.9116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5310 -8.5129 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.8700 -8.6608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8723 -10.1616 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.5720 -10.9110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2723 -10.1604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2326 -10.7595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2729 -8.9604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.1728 -10.9108 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-8.2112 -10.3095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.1715 -9.7108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.1751 -12.4116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8773 -13.1637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8796 -14.6637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.1798 -15.4116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.1853 -16.9125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-8.2263 -17.5094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.4777 -14.6596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.4753 -13.1596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
11 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
14 22 1 0
22 23 1 0
22 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
27 29 1 0
25 30 1 0
30 31 2 0
30 32 2 0
30 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 1 0
36 39 1 0
39 40 2 0
40 33 1 0
9 41 1 0
41 3 1 0
41 6 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 592.71Molecular Weight (Monoisotopic): 592.2455AlogP: 2.43#Rotatable Bonds: 13Polar Surface Area: 132.86Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.49CX Basic pKa: ┄CX LogP: 2.95CX LogD: 2.95Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.36Np Likeness Score: -0.02
References 1. (2014) Processes and intermediates for preparing substituted hexahydrofuro [2,3-b] furans,