US8895592, 16

ID: ALA3647315

PubChem CID: 46833820

Max Phase: Preclinical

Molecular Formula: C23H29N3O2S

Molecular Weight: 411.57

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)Cn1cc(C(C)(C)C)s/c1=N\C(=O)c1cc(C#N)ccc1OC1CCC1

Standard InChI:  InChI=1S/C23H29N3O2S/c1-15(2)13-26-14-20(23(3,4)5)29-22(26)25-21(27)18-11-16(12-24)9-10-19(18)28-17-7-6-8-17/h9-11,14-15,17H,6-8,13H2,1-5H3/b25-22-

Standard InChI Key:  HWNSLBVHLLZKAP-LVWGJNHUSA-N

Molfile:  

     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
    8.5223    2.2429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2794    1.0677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1760    0.2701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8550    0.5950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5517   -0.8722    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5554   -1.9869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8054   -3.2859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3382   -2.9741    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.2003   -1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6024   -2.6977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0031   -3.0008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3039   -3.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6523   -5.1712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0999   -4.7779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7066   -3.3304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    4.2008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4148   -4.6546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6082   -4.7808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7092   -5.6252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9024   -5.7511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 20  1  0
 15 24  1  0
 24 25  3  0
  7 26  1  0
 26 27  1  0
 26 28  1  0
 26 29  1  0
M  END

Associated Targets(Human)

CNR2 Tchem Cannabinoid CB2 receptor (16942 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Cnr2 Cannabinoid CB2 receptor (721 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 411.57Molecular Weight (Monoisotopic): 411.1980AlogP: 5.05#Rotatable Bonds: 5
Polar Surface Area: 67.38Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 1.90CX LogP: 5.54CX LogD: 5.54
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.69Np Likeness Score: -1.18

References

1.  (2014)  Compounds as cannabinoid receptor ligands, 

Source

Source(1):