US8895592, 25

ID: ALA3647324

PubChem CID: 46834107

Max Phase: Preclinical

Molecular Formula: C22H23F3N4O3S

Molecular Weight: 480.51

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCn1/c(=N/C(=O)c2cc(C(F)(F)F)ccc2OCCNC(C)=O)sc2ccncc21

Standard InChI:  InChI=1S/C22H23F3N4O3S/c1-3-4-10-29-17-13-26-8-7-19(17)33-21(29)28-20(31)16-12-15(22(23,24)25)5-6-18(16)32-11-9-27-14(2)30/h5-8,12-13H,3-4,9-11H2,1-2H3,(H,27,30)/b28-21-

Standard InChI Key:  XMPMTLNMPQEQQM-HFTWOUSFSA-N

Molfile:  

     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   -0.8533   -7.7666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2256   -6.6258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2234   -5.5086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6890   -4.0818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3114   -2.9665    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5551   -4.4192    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0559   -4.4171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6541   -3.3768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8090   -5.7153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0591   -7.0144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8092   -8.3134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3092   -8.3134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0591   -7.0143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3090   -5.7153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0621   -4.4171    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5629   -4.4192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3160   -3.1210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8168   -3.1231    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5699   -1.8249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7699   -1.8266    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9717   -0.7846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0588   -9.6132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8588   -9.6140    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.6592  -10.6522    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.4594  -10.6528    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.4133   -1.7530    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 20 22  1  0
 12 23  1  0
 23 24  1  0
 23 25  1  0
 23 26  1  0
  6 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33  5  1  0
 33 28  1  0
M  END

Associated Targets(Human)

CNR2 Tchem Cannabinoid CB2 receptor (16942 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Cnr2 Cannabinoid CB2 receptor (721 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 480.51Molecular Weight (Monoisotopic): 480.1443AlogP: 4.17#Rotatable Bonds: 8
Polar Surface Area: 85.58Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.56CX LogP: 3.26CX LogD: 3.26
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.49Np Likeness Score: -2.00

References

1.  (2014)  Compounds as cannabinoid receptor ligands, 

Source

Source(1):