The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8895592, 30 ID: ALA3647329
PubChem CID: 46834382
Max Phase: Preclinical
Molecular Formula: C23H28F3N3O2S
Molecular Weight: 467.56
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C#CCCn1cc(C(C)(C)C)s/c1=N\C(=O)c1cc(C(F)(F)F)ccc1ONC(C)(C)C
Standard InChI: InChI=1S/C23H28F3N3O2S/c1-8-9-12-29-14-18(21(2,3)4)32-20(29)27-19(30)16-13-15(23(24,25)26)10-11-17(16)31-28-22(5,6)7/h1,10-11,13-14,28H,9,12H2,2-7H3/b27-20-
Standard InChI Key: WUPPCSOXCMCCLQ-OOAXWGSJSA-N
Molfile:
RDKit 2D
32 33 0 0 0 0 0 0 0 0999 V2000
6.2387 -0.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2024 -2.6932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2405 -2.0916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 -3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0351 -3.6026 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 -3.7494 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3070 -5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0934 -6.1101 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.5570 -7.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0570 -7.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5205 -6.1100 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9427 -5.6391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0643 -6.6363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4891 -6.1645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.6282 -5.7873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3237 -8.7487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5172 -8.6241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1648 -9.8448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0285 -9.7199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5988 1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5996 2.7004 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.6378 0.9001 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.6383 2.0999 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 1 0
2 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
12 13 1 0
13 14 2 0
13 15 1 0
15 16 2 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 16 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 3 0
18 25 1 0
25 26 1 0
25 27 1 0
25 28 1 0
10 29 1 0
29 30 1 0
29 31 1 0
29 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 467.56Molecular Weight (Monoisotopic): 467.1854AlogP: 5.31#Rotatable Bonds: 5Polar Surface Area: 55.62Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 3.98CX LogP: 5.68CX LogD: 5.68Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.48Np Likeness Score: -1.32
References 1. (2014) Compounds as cannabinoid receptor ligands,