The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8895592, 33 ID: ALA3647332
PubChem CID: 46834385
Max Phase: Preclinical
Molecular Formula: C24H27F3N4O2S
Molecular Weight: 492.57
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCn1/c(=N/C(=O)c2cc(C(F)(F)F)ccc2OC[C@@H]2CCCN2C)sc2ccncc21
Standard InChI: InChI=1S/C24H27F3N4O2S/c1-3-4-12-31-19-14-28-10-9-21(19)34-23(31)29-22(32)18-13-16(24(25,26)27)7-8-20(18)33-15-17-6-5-11-30(17)2/h7-10,13-14,17H,3-6,11-12,15H2,1-2H3/b29-23-/t17-/m0/s1
Standard InChI Key: OLBHKQSIRBSVEG-GEXONFBESA-N
Molfile:
RDKit 2D
34 37 0 0 1 0 0 0 0 0999 V2000
-0.8533 -7.7666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2256 -6.6258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2234 -5.5086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6890 -4.0818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5551 -4.4192 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0559 -4.4171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6541 -3.3768 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8090 -5.7153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0591 -7.0144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8092 -8.3134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3092 -8.3134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0591 -7.0143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3090 -5.7153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0621 -4.4171 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5629 -4.4192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3160 -3.1210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6949 -1.7696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8097 -0.7659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1087 -1.5158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7968 -2.9831 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5945 -3.8796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0588 -9.6132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8588 -9.6140 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.6592 -10.6522 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.4594 -10.6528 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
8 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
15 16 1 0
16 17 1 0
18 17 1 6
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 18 1 0
22 23 1 0
12 24 1 0
24 25 1 0
24 26 1 0
24 27 1 0
6 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 5 1 0
34 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 492.57Molecular Weight (Monoisotopic): 492.1807AlogP: 5.13#Rotatable Bonds: 7Polar Surface Area: 59.72Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.89CX LogP: 4.73CX LogD: 4.12Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.46Np Likeness Score: -1.67
References 1. (2014) Compounds as cannabinoid receptor ligands,