The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8895592, 36 ID: ALA3647333
PubChem CID: 46834664
Max Phase: Preclinical
Molecular Formula: C21H22F3N3O3S
Molecular Weight: 453.49
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCn1/c(=N/C(=O)c2cc(C(F)(F)F)ccc2OC[C@H](C)O)sc2ncccc21
Standard InChI: InChI=1S/C21H22F3N3O3S/c1-3-4-10-27-16-6-5-9-25-19(16)31-20(27)26-18(29)15-11-14(21(22,23)24)7-8-17(15)30-12-13(2)28/h5-9,11,13,28H,3-4,10,12H2,1-2H3/b26-20-/t13-/m0/s1
Standard InChI Key: ALPMIDBDCVDTKH-XQUWXSQBSA-N
Molfile:
RDKit 2D
31 33 0 0 1 0 0 0 0 0999 V2000
-0.8533 -7.7666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2256 -6.6258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2234 -5.5086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6890 -4.0818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5551 -4.4192 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0559 -4.4171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6541 -3.3768 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8090 -5.7153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0591 -7.0144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8092 -8.3134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3092 -8.3134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0591 -7.0143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3090 -5.7153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0621 -4.4171 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5629 -4.4192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3160 -3.1210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7178 -2.0807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5160 -3.1226 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0588 -9.6132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8588 -9.6140 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.6592 -10.6522 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.4594 -10.6528 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
8 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 6
18 20 1 0
12 21 1 0
21 22 1 0
21 23 1 0
21 24 1 0
6 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 5 1 0
31 26 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 453.49Molecular Weight (Monoisotopic): 453.1334AlogP: 4.42#Rotatable Bonds: 7Polar Surface Area: 76.71Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 1.57CX LogP: 4.56CX LogD: 4.56Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.57Np Likeness Score: -1.64
References 1. (2014) Compounds as cannabinoid receptor ligands,