US8895592, 37

ID: ALA3647334

PubChem CID: 46834945

Max Phase: Preclinical

Molecular Formula: C25H28F3N5O2S

Molecular Weight: 519.59

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCn1cc(C(C)(C)C)s/c1=N\C(=O)c1cc(C(F)(F)F)ccc1NNC(=O)c1cccnc1

Standard InChI:  InChI=1S/C25H28F3N5O2S/c1-5-6-12-33-15-20(24(2,3)4)36-23(33)30-22(35)18-13-17(25(26,27)28)9-10-19(18)31-32-21(34)16-8-7-11-29-14-16/h7-11,13-15,31H,5-6,12H2,1-4H3,(H,32,34)/b30-23-

Standard InChI Key:  QWRKHIVLDAAWQV-WMMMYUQOSA-N

Molfile:  

     RDKit          2D

 36 38  0  0  0  0  0  0  0  0999 V2000
    9.7221    2.9155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5831    2.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2794    1.0677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8550    0.5950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5517   -0.8722    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5554   -1.9869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8054   -3.2859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3382   -2.9741    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.2003   -1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6024   -2.6977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0031   -3.0008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3039   -3.7494    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3070   -5.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2688   -5.8520    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6078   -5.9988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6131   -7.4988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9147   -8.2443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2111   -7.4898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2060   -5.9898    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9043   -5.2443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0388    3.6015    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0394    3.6005    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0006    4.2008    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.4148   -4.6546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6082   -4.7808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7092   -5.6252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9024   -5.7511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 15 29  1  0
 29 30  1  0
 29 31  1  0
 29 32  1  0
  7 33  1  0
 33 34  1  0
 33 35  1  0
 33 36  1  0
M  END

Associated Targets(Human)

CNR2 Tchem Cannabinoid CB2 receptor (16942 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Cnr2 Cannabinoid CB2 receptor (721 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 519.59Molecular Weight (Monoisotopic): 519.1916AlogP: 5.56#Rotatable Bonds: 7
Polar Surface Area: 88.38Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.89CX Basic pKa: 3.56CX LogP: 6.27CX LogD: 6.27
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.40Np Likeness Score: -1.79

References

1.  (2014)  Compounds as cannabinoid receptor ligands, 

Source

Source(1):