The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8895592, 37 ID: ALA3647334
PubChem CID: 46834945
Max Phase: Preclinical
Molecular Formula: C25H28F3N5O2S
Molecular Weight: 519.59
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCn1cc(C(C)(C)C)s/c1=N\C(=O)c1cc(C(F)(F)F)ccc1NNC(=O)c1cccnc1
Standard InChI: InChI=1S/C25H28F3N5O2S/c1-5-6-12-33-15-20(24(2,3)4)36-23(33)30-22(35)18-13-17(25(26,27)28)9-10-19(18)31-32-21(34)16-8-7-11-29-14-16/h7-11,13-15,31H,5-6,12H2,1-4H3,(H,32,34)/b30-23-
Standard InChI Key: QWRKHIVLDAAWQV-WMMMYUQOSA-N
Molfile:
RDKit 2D
36 38 0 0 0 0 0 0 0 0999 V2000
9.7221 2.9155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5831 2.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2794 1.0677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8550 0.5950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5517 -0.8722 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5554 -1.9869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8054 -3.2859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3382 -2.9741 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6024 -2.6977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 -3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 -3.7494 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3070 -5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2688 -5.8520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6078 -5.9988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6131 -7.4988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9147 -8.2443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2111 -7.4898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2060 -5.9898 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9043 -5.2443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0388 3.6015 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.0394 3.6005 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.0006 4.2008 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.4148 -4.6546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6082 -4.7808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7092 -5.6252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9024 -5.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 1 0
9 5 1 0
9 10 2 0
10 11 1 0
11 12 2 0
11 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
21 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
15 29 1 0
29 30 1 0
29 31 1 0
29 32 1 0
7 33 1 0
33 34 1 0
33 35 1 0
33 36 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 519.59Molecular Weight (Monoisotopic): 519.1916AlogP: 5.56#Rotatable Bonds: 7Polar Surface Area: 88.38Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.89CX Basic pKa: 3.56CX LogP: 6.27CX LogD: 6.27Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.40Np Likeness Score: -1.79
References 1. (2014) Compounds as cannabinoid receptor ligands,