US8901310, Comparator B

ID: ALA3647440

PubChem CID: 57720816

Max Phase: Preclinical

Molecular Formula: C29H30F3N3O2

Molecular Weight: 509.57

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cnc(NC(=O)c2ccc3c(c2)CC[C@@H]2C[C@@](O)(C(F)(F)F)CC[C@@]32Cc2ccccc2)c(C)n1

Standard InChI:  InChI=1S/C29H30F3N3O2/c1-18-17-33-25(19(2)34-18)35-26(36)22-9-11-24-21(14-22)8-10-23-16-28(37,29(30,31)32)13-12-27(23,24)15-20-6-4-3-5-7-20/h3-7,9,11,14,17,23,37H,8,10,12-13,15-16H2,1-2H3,(H,33,35,36)/t23-,27+,28-/m1/s1

Standard InChI Key:  VLRUOHNPKMZQHN-KEKPKEOLSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  1  0  0  0  0  0999 V2000
    7.5307   -5.8571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4915   -5.2571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4915   -3.7571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1925   -3.0070    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8933   -3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6375   -0.9049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1962    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1962    3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2204    2.3747    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2983    2.2504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2974    3.7512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0006    4.5032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0015    6.0032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3016    6.7513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5996    5.9995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5975    4.4995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1597    4.4800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1207    5.0804    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1600    5.6800    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1990    5.0799    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8934   -5.2570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8542   -5.8570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1924   -6.0070    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 16 15  1  6
 16 17  1  0
 17 18  1  0
 18 19  1  6
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 12  1  0
 22 16  1  0
 22 23  1  6
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 18 30  1  0
 30 31  1  0
 30 32  1  0
 30 33  1  0
 13 34  2  0
 34  9  1  0
  5 35  1  0
 35 36  1  0
 35 37  2  0
 37  2  1  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

NR3C1 Tclin Glucocorticoid receptor (14987 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
IL6 Tclin Interleukin-6 (43 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 509.57Molecular Weight (Monoisotopic): 509.2290AlogP: 5.87#Rotatable Bonds: 4
Polar Surface Area: 75.11Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.24CX Basic pKa: 1.46CX LogP: 5.31CX LogD: 5.31
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.46Np Likeness Score: -0.02

References

1.  (2014)  Tricyclic compounds, compositions, and methods, 

Source

Source(1):