The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8901310, Comparator E ID: ALA3647443
PubChem CID: 68226933
Max Phase: Preclinical
Molecular Formula: C29H27F3N2O3
Molecular Weight: 508.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ncccc1NC(=O)c1ccc2c(c1)C(=O)C[C@@H]1C[C@@](O)(C(F)(F)F)CC[C@@]21Cc1ccccc1
Standard InChI: InChI=1S/C29H27F3N2O3/c1-18-24(8-5-13-33-18)34-26(36)20-9-10-23-22(14-20)25(35)15-21-17-28(37,29(30,31)32)12-11-27(21,23)16-19-6-3-2-4-7-19/h2-10,13-14,21,37H,11-12,15-17H2,1H3,(H,34,36)/t21-,27+,28-/m1/s1
Standard InChI Key: MLZLXEBPLLEJSK-AOLGGSBGSA-N
Molfile:
RDKit 2D
37 41 0 0 1 0 0 0 0 0999 V2000
2.8542 -5.8570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8934 -5.2570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1924 -6.0070 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4915 -5.2571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4915 -3.7571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1925 -3.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6375 -0.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -2.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1962 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1962 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2204 2.3747 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2983 2.2504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2974 3.7512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0006 4.5032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0015 6.0032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3016 6.7513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5996 5.9995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5975 4.4995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1597 4.4800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1207 5.0804 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-5.1600 5.6800 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-6.1990 5.0799 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
7 8 1 0
8 9 1 0
9 10 2 0
9 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
15 17 1 0
17 18 2 0
17 19 1 0
20 19 1 6
20 21 1 0
21 22 1 0
22 23 1 6
22 24 1 0
24 25 1 0
25 26 1 0
26 14 1 0
26 20 1 0
26 27 1 6
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
22 34 1 0
34 35 1 0
34 36 1 0
34 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 508.54Molecular Weight (Monoisotopic): 508.1974AlogP: 5.80#Rotatable Bonds: 4Polar Surface Area: 79.29Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.24CX Basic pKa: 5.20CX LogP: 4.66CX LogD: 4.65Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.47Np Likeness Score: 0.13
References 1. (2014) Tricyclic compounds, compositions, and methods,