The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8901310, Comparator I ID: ALA3647447
PubChem CID: 68226610
Max Phase: Preclinical
Molecular Formula: C29H27F3N2O2
Molecular Weight: 492.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ncccc1NC(=O)c1ccc2c(c1)C=C[C@@H]1C[C@@](O)(C(F)(F)F)CC[C@@]21Cc1ccccc1
Standard InChI: InChI=1S/C29H27F3N2O2/c1-19-25(8-5-15-33-19)34-26(35)22-10-12-24-21(16-22)9-11-23-18-28(36,29(30,31)32)14-13-27(23,24)17-20-6-3-2-4-7-20/h2-12,15-16,23,36H,13-14,17-18H2,1H3,(H,34,35)/t23-,27+,28-/m1/s1
Standard InChI Key: UHIXENGVNOWISA-KEKPKEOLSA-N
Molfile:
RDKit 2D
36 40 0 0 1 0 0 0 0 0999 V2000
2.8542 -5.8570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8934 -5.2570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1924 -6.0070 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4915 -5.2571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4915 -3.7571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1925 -3.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6375 -0.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1962 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1962 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2204 2.3747 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8971 3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2983 2.2504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2974 3.7512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0006 4.5032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0015 6.0032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3016 6.7513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5996 5.9995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5975 4.4995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1597 4.4800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1207 5.0804 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-5.1600 5.6800 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-6.1990 5.0799 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
7 8 1 0
8 9 1 0
9 10 2 0
9 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 17 2 0
18 17 1 6
18 19 1 0
19 20 1 0
20 21 1 6
20 22 1 0
22 23 1 0
23 24 1 0
24 14 1 0
24 18 1 0
24 25 1 6
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
20 32 1 0
32 33 1 0
32 34 1 0
32 35 1 0
15 36 2 0
36 11 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 492.54Molecular Weight (Monoisotopic): 492.2025AlogP: 6.24#Rotatable Bonds: 4Polar Surface Area: 62.22Molecular Species: NEUTRALHBA: 3HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.23CX Basic pKa: 5.20CX LogP: 5.52CX LogD: 5.52Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.45Np Likeness Score: 0.27
References 1. (2014) Tricyclic compounds, compositions, and methods,